Difference between revisions of "PWY-6383"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19220 CPD-19220] == * smiles: ** C(O)C1(O)(CC(=O)C(O)=C(O)C1) * common name: ** (S)-demethy...") |
|||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6383 PWY-6383] == |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** mono-trans, poly-cis decaprenyl phosphate biosynthesis |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1762 TAX-1762] |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[RXN- | + | '''2''' reactions found over '''5''' reactions in the full pathway |
| − | + | * [[GPPSYN-RXN]] | |
| − | == Reaction(s) | + | ** 9 associated gene(s): |
| − | * [[RXN- | + | *** [[CHC_T00005639001_1]] |
| + | *** [[CHC_T00003042001_1]] | ||
| + | *** [[CHC_T00004833001_1]] | ||
| + | *** [[CHC_T00002263001_1]] | ||
| + | *** [[CHC_T00002324001_1]] | ||
| + | *** [[CHC_T00006851001_1]] | ||
| + | *** [[CHC_T00008377001_1]] | ||
| + | *** [[CHC_T00000930001_1]] | ||
| + | *** [[CHC_T00008265001_1]] | ||
| + | ** 3 reconstruction source(s) associated: | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | *** [[orthology-arabidopsis_thaliana]] | ||
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | * [[IPPISOM-RXN]] | ||
| + | ** 2 associated gene(s): | ||
| + | *** [[CHC_T00001581001_1]] | ||
| + | *** [[CHC_T00006126001_1]] | ||
| + | ** 3 reconstruction source(s) associated: | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | *** [[orthology-arabidopsis_thaliana]] | ||
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=2.5.1.68-RXN 2.5.1.68-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11023 RXN-11023] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11027 RXN-11027] | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=mono-trans, poly-cis decaprenyl phosphate biosynthesis}} | |
| − | {{#set: common name= | + | {{#set: taxonomic range=TAX-1762}} |
| − | {{#set: | + | {{#set: reaction found=2}} |
| − | {{#set: | + | {{#set: total reaction=5}} |
| − | {{#set: | + | {{#set: completion rate=40.0}} |
| − | {{#set: | + | |
| − | + | ||
Latest revision as of 16:40, 9 January 2019
Pathway PWY-6383
- common name:
- mono-trans, poly-cis decaprenyl phosphate biosynthesis
- taxonomic range:
- Synonym(s):
Reaction(s) found
2 reactions found over 5 reactions in the full pathway
- GPPSYN-RXN
- 9 associated gene(s):
- 3 reconstruction source(s) associated:
- IPPISOM-RXN
- 2 associated gene(s):
- 3 reconstruction source(s) associated:
