Difference between revisions of "CPD-17814"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PANTOTHENATE-KIN-RXN PANTOTHENATE-KIN-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http:/...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=PANTOTHENATE-KIN-RXN PANTOTHENATE-KIN-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17814 CPD-17814] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CCCCC=CCCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O
* ec number:
+
* molecular weight:
** [http://enzyme.expasy.org/EC/2.7.1.33 EC-2.7.1.33]
+
** 1015.898   
 +
* inchi key:
 +
** InChIKey=SHGDVNGLFXVIAK-BFVORPHASA-J
 +
* common name:
 +
** (11Z)-(S)-3-hydroxyhexadec-11-enoyl-CoA
 
* Synonym(s):
 
* Synonym(s):
** type III pantothenate kinase
 
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[ATP]][c] '''+''' 1 [[PANTOTHENATE]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[4-P-PANTOTHENATE]][c] '''+''' 1 [[PROTON]][c]
+
* [[RXN-16558]]
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 ATP[c] '''+''' 1 (R)-pantothenate[c] '''=>''' 1 ADP[c] '''+''' 1 (R)-4'-phosphopantothenate[c] '''+''' 1 H+[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[CHC_T00006632001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
* [[CHC_T00002958001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
* [[CHC_T00002103001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
== Pathways  ==
+
* [[PANTO-PWY]], phosphopantothenate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PANTO-PWY PANTO-PWY]
+
** '''4''' reactions found over '''4''' reactions in the full pathway
+
* [[PWY-3961]], phosphopantothenate biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3961 PWY-3961]
+
** '''1''' reactions found over '''3''' reactions in the full pathway
+
* [[COA-PWY-1]], coenzyme A biosynthesis II (mammalian): [http://metacyc.org/META/NEW-IMAGE?object=COA-PWY-1 COA-PWY-1]
+
** '''4''' reactions found over '''5''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[galdieria.sulphuraria]]
+
 
== External links  ==
 
== External links  ==
* RHEA:
+
* PUBCHEM:
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=16373 16373]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820456 91820456]
* LIGAND-RXN:
+
{{#set: smiles=CCCCC=CCCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O}}
** [http://www.genome.jp/dbget-bin/www_bget?R03018 R03018]
+
{{#set: molecular weight=1015.898    }}
* UNIPROT:
+
{{#set: inchi key=InChIKey=SHGDVNGLFXVIAK-BFVORPHASA-J}}
** [http://www.uniprot.org/uniprot/P0A6I3 P0A6I3]
+
{{#set: common name=(11Z)-(S)-3-hydroxyhexadec-11-enoyl-CoA}}
** [http://www.uniprot.org/uniprot/Q9CFM3 Q9CFM3]
+
{{#set: produced by=RXN-16558}}
** [http://www.uniprot.org/uniprot/P44793 P44793]
+
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: ec number=EC-2.7.1.33}}
+
{{#set: common name=type III pantothenate kinase}}
+
{{#set: gene associated=CHC_T00006632001_1|CHC_T00002958001_1|CHC_T00002103001_1}}
+
{{#set: in pathway=PANTO-PWY|PWY-3961|COA-PWY-1}}
+
{{#set: reconstruction category=orthology}}
+
{{#set: reconstruction tool=pantograph}}
+
{{#set: reconstruction source=galdieria.sulphuraria}}
+

Latest revision as of 16:43, 9 January 2019

Metabolite CPD-17814

  • smiles:
    • CCCCC=CCCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O
  • molecular weight:
    • 1015.898
  • inchi key:
    • InChIKey=SHGDVNGLFXVIAK-BFVORPHASA-J
  • common name:
    • (11Z)-(S)-3-hydroxyhexadec-11-enoyl-CoA
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCC=CCCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O" cannot be used as a page name in this wiki.