Difference between revisions of "CPD-13717"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13717 CPD-13717] == * smiles: ** C([Se]CC(C([O-])=O)[N+])CC([N+])C(=O)[O-] * inchi key: **...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C([Se]CC(C([O-])=O)[N+])CC([N+])C(=O)[O-] | ** C([Se]CC(C([O-])=O)[N+])CC([N+])C(=O)[O-] | ||
+ | * molecular weight: | ||
+ | ** 269.159 | ||
* inchi key: | * inchi key: | ||
** InChIKey=ZNWYDQPOUQRDLY-WHFBIAKZSA-N | ** InChIKey=ZNWYDQPOUQRDLY-WHFBIAKZSA-N | ||
* common name: | * common name: | ||
** L-selenocystathionine | ** L-selenocystathionine | ||
− | |||
− | |||
* Synonym(s): | * Synonym(s): | ||
Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62226 62226] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62226 62226] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52921580 52921580] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C05699 C05699] | ** [http://www.genome.jp/dbget-bin/www_bget?C05699 C05699] | ||
* HMDB : HMDB06343 | * HMDB : HMDB06343 | ||
{{#set: smiles=C([Se]CC(C([O-])=O)[N+])CC([N+])C(=O)[O-]}} | {{#set: smiles=C([Se]CC(C([O-])=O)[N+])CC([N+])C(=O)[O-]}} | ||
+ | {{#set: molecular weight=269.159 }} | ||
{{#set: inchi key=InChIKey=ZNWYDQPOUQRDLY-WHFBIAKZSA-N}} | {{#set: inchi key=InChIKey=ZNWYDQPOUQRDLY-WHFBIAKZSA-N}} | ||
{{#set: common name=L-selenocystathionine}} | {{#set: common name=L-selenocystathionine}} | ||
− | |||
{{#set: consumed by=RXN-12729|RXN-15137}} | {{#set: consumed by=RXN-12729|RXN-15137}} |
Latest revision as of 17:44, 9 January 2019
Contents
Metabolite CPD-13717
- smiles:
- C([Se]CC(C([O-])=O)[N+])CC([N+])C(=O)[O-]
- molecular weight:
- 269.159
- inchi key:
- InChIKey=ZNWYDQPOUQRDLY-WHFBIAKZSA-N
- common name:
- L-selenocystathionine
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([Se]CC(C([O-])=O)[N+])CC([N+])C(=O)[O-" cannot be used as a page name in this wiki.