Difference between revisions of "5734-TETRAHYDROXYFLAVONE"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00009202001_1 == * Synonym(s): == Reactions associated == * 2.7.10.1-RXN ** pantograph-galdieria.sulphuraria * PROTEIN-KINASE-RXN...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5734-TETRAHYDROXYFLAVONE 5734-TETRAHYDROXYFLAVONE] == |
+ | * smiles: | ||
+ | ** C1(=C(C=C(O)C(O)=C1)C2(OC3(C=C([O-])C=C(O)C(C(=O)C=2)=3))) | ||
+ | * molecular weight: | ||
+ | ** 285.232 | ||
+ | * inchi key: | ||
+ | ** InChIKey=IQPNAANSBPBGFQ-UHFFFAOYSA-M | ||
+ | * common name: | ||
+ | ** luteolin | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 3',4',5,7-tetrahydroxyflavone | ||
+ | ** 5,7,3',4'-tetrahydroxyflavone | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-7651]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57545 57545] | ||
+ | * CAS : 491-70-3 | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201972 25201972] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01514 C01514] | ||
+ | * HMDB : HMDB05800 | ||
+ | {{#set: smiles=C1(=C(C=C(O)C(O)=C1)C2(OC3(C=C([O-])C=C(O)C(C(=O)C=2)=3)))}} | ||
+ | {{#set: molecular weight=285.232 }} | ||
+ | {{#set: inchi key=InChIKey=IQPNAANSBPBGFQ-UHFFFAOYSA-M}} | ||
+ | {{#set: common name=luteolin}} | ||
+ | {{#set: common name=3',4',5,7-tetrahydroxyflavone|5,7,3',4'-tetrahydroxyflavone}} | ||
+ | {{#set: produced by=RXN-7651}} |
Latest revision as of 16:44, 9 January 2019
Contents
Metabolite 5734-TETRAHYDROXYFLAVONE
- smiles:
- C1(=C(C=C(O)C(O)=C1)C2(OC3(C=C([O-])C=C(O)C(C(=O)C=2)=3)))
- molecular weight:
- 285.232
- inchi key:
- InChIKey=IQPNAANSBPBGFQ-UHFFFAOYSA-M
- common name:
- luteolin
- Synonym(s):
- 3',4',5,7-tetrahydroxyflavone
- 5,7,3',4'-tetrahydroxyflavone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(=C(C=C(O)C(O)=C1)C2(OC3(C=C([O-])C=C(O)C(C(=O)C=2)=3)))" cannot be used as a page name in this wiki.