Difference between revisions of "CPD-7015"

From metabolic_network
Jump to: navigation, search
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6893 PWY-6893] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7015 CPD-7015] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(CO)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
 +
* molecular weight:
 +
** 628.966   
 
* common name:
 
* common name:
** thiamine diphosphate biosynthesis II (Bacillus)
+
** 71-hydroxychlorophyllide a
 
* Synonym(s):
 
* Synonym(s):
** vitamin B1 biosynthesis II
+
** 7-hydroxychlorophyllide a (misleading)
** thiamin diphosphate biosynthesis II (Bacillus)
+
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''1''' reactions found over '''2''' reactions in the full pathway
+
* [[RXN-7677]]
* [[RXN-12610]]
+
== Reaction(s) known to produce the compound ==
== Reaction(s) not found ==
+
* [[RXN-7676]]
* [http://metacyc.org/META/NEW-IMAGE?object=THI-P-KIN-RXN THI-P-KIN-RXN]
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-2}}
+
* PUBCHEM:
{{#set: common name=thiamine diphosphate biosynthesis II (Bacillus)}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657206 90657206]
{{#set: common name=vitamin B1 biosynthesis II|thiamin diphosphate biosynthesis II (Bacillus)}}
+
* LIGAND-CPD:
{{#set: reaction found=1}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C16540 C16540]
{{#set: reaction not found=2}}
+
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(CO)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
{{#set: completion rate=50.0}}
+
{{#set: molecular weight=628.966    }}
 +
{{#set: common name=71-hydroxychlorophyllide a}}
 +
{{#set: common name=7-hydroxychlorophyllide a (misleading)}}
 +
{{#set: consumed by=RXN-7677}}
 +
{{#set: produced by=RXN-7676}}

Latest revision as of 16:45, 9 January 2019

Metabolite CPD-7015

  • smiles:
    • C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(CO)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
  • molecular weight:
    • 628.966
  • common name:
    • 71-hydroxychlorophyllide a
  • Synonym(s):
    • 7-hydroxychlorophyllide a (misleading)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(CO)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))" cannot be used as a page name in this wiki.