Difference between revisions of "CPD-15668"

From metabolic_network
Jump to: navigation, search
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=P124-PWY P124-PWY] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15668 CPD-15668] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-201174 TAX-201174]
+
** CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 +
* molecular weight:
 +
** 929.765   
 +
* inchi key:
 +
** InChIKey=AFMMIIQKXQNEDN-NSDZGHCESA-J
 
* common name:
 
* common name:
** Bifidobacterium shunt
+
** 4-cis-undecenoyl-CoA
 
* Synonym(s):
 
* Synonym(s):
** Bifidum fermentation
+
** 4Z-undecenoyl-CoA
** Bifidum pathway
+
** fructose-6-phosphate pathway
+
** Bifidum shunt
+
** glucose fermentation to lactate (Bifidobacteria)
+
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''11''' reactions found over '''15''' reactions in the full pathway
+
* [[RXN-14775]]
* [[1TRANSKETO-RXN]]
+
== Reaction(s) known to produce the compound ==
* [[2PGADEHYDRAT-RXN]]
+
* [[RXN-14774]]
* [[3PGAREARR-RXN]]
+
== Reaction(s) of unknown directionality ==
* [[GAPOXNPHOSPHN-RXN]]
+
* [[GLUCOKIN-RXN]]
+
* [[PEPDEPHOS-RXN]]
+
* [[PGLUCISOM-RXN]]
+
* [[PHOSGLYPHOS-RXN]]
+
* [[RIB5PISOM-RXN]]
+
* [[RIBULP3EPIM-RXN]]
+
* [[TRANSALDOL-RXN]]
+
== Reaction(s) not found ==
+
* [http://metacyc.org/META/NEW-IMAGE?object=ACETATEKIN-RXN ACETATEKIN-RXN]
+
* [http://metacyc.org/META/NEW-IMAGE?object=FRUCTOSE-6-PHOSPHATE-PHOSPHOKETOLASE-RXN FRUCTOSE-6-PHOSPHATE-PHOSPHOKETOLASE-RXN]
+
* [http://metacyc.org/META/NEW-IMAGE?object=L-LACTATE-DEHYDROGENASE-RXN L-LACTATE-DEHYDROGENASE-RXN]
+
* [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHOKETOLASE-RXN PHOSPHOKETOLASE-RXN]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-201174}}
+
* PUBCHEM:
{{#set: common name=Bifidobacterium shunt}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658173 90658173]
{{#set: common name=Bifidum fermentation|Bifidum pathway|fructose-6-phosphate pathway|Bifidum shunt|glucose fermentation to lactate (Bifidobacteria)}}
+
{{#set: smiles=CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
{{#set: reaction found=11}}
+
{{#set: molecular weight=929.765    }}
{{#set: reaction not found=15}}
+
{{#set: inchi key=InChIKey=AFMMIIQKXQNEDN-NSDZGHCESA-J}}
{{#set: completion rate=73.0}}
+
{{#set: common name=4-cis-undecenoyl-CoA}}
 +
{{#set: common name=4Z-undecenoyl-CoA}}
 +
{{#set: consumed by=RXN-14775}}
 +
{{#set: produced by=RXN-14774}}

Latest revision as of 16:46, 9 January 2019

Metabolite CPD-15668

  • smiles:
    • CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • molecular weight:
    • 929.765
  • inchi key:
    • InChIKey=AFMMIIQKXQNEDN-NSDZGHCESA-J
  • common name:
    • 4-cis-undecenoyl-CoA
  • Synonym(s):
    • 4Z-undecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.