Difference between revisions of "SELENOHOMOCYSTEINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4184 CPD-4184] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(O)...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SELENOHOMOCYSTEINE SELENOHOMOCYSTEINE] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(C[Se])C([N+])C(=O)[O-] |
+ | * molecular weight: | ||
+ | ** 181.073 | ||
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=RCWCGLALNCIQNM-VKHMYHEASA-N |
* common name: | * common name: | ||
− | ** | + | ** seleno-L-homocysteine |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 2-amino-4-selanyl-butanoate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-12730]] |
− | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-12729]] | ||
+ | * [[RXN-15137]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84850 84850] |
+ | * METABOLIGHTS : MTBLC9096 | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659042 90659042] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05698 C05698] |
− | {{#set: smiles= | + | * HMDB : HMDB04119 |
− | {{#set: inchi key=InChIKey= | + | {{#set: smiles=C(C[Se])C([N+])C(=O)[O-]}} |
− | {{#set: common name= | + | {{#set: molecular weight=181.073 }} |
− | {{#set: | + | {{#set: inchi key=InChIKey=RCWCGLALNCIQNM-VKHMYHEASA-N}} |
− | {{#set: | + | {{#set: common name=seleno-L-homocysteine}} |
+ | {{#set: common name=2-amino-4-selanyl-butanoate}} | ||
+ | {{#set: consumed by=RXN-12730}} | ||
+ | {{#set: produced by=RXN-12729|RXN-15137}} |
Latest revision as of 17:47, 9 January 2019
Contents
Metabolite SELENOHOMOCYSTEINE
- smiles:
- C(C[Se])C([N+])C(=O)[O-]
- molecular weight:
- 181.073
- inchi key:
- InChIKey=RCWCGLALNCIQNM-VKHMYHEASA-N
- common name:
- seleno-L-homocysteine
- Synonym(s):
- 2-amino-4-selanyl-butanoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C[Se])C([N+])C(=O)[O-" cannot be used as a page name in this wiki.