Difference between revisions of "LINOLENOYL-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14018 CPD-14018] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)C...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14018 CPD-14018] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=LINOLENOYL-RXN LINOLENOYL-RXN] ==
* smiles:
+
* direction:
** CCC=CCC=CCC=CCC=CCC=CCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=JWZLRYCDDXHXDL-LCMHIRPZSA-J
+
 
* common name:
 
* common name:
** icosapentaenoyl-CoA
+
** long-chain-fatty-acid-CoA ligase
* molecular weight:
+
* ec number:
** 1047.943   
+
** [http://enzyme.expasy.org/EC/6.2.1.3 EC-6.2.1.3]
 
* Synonym(s):
 
* Synonym(s):
** (5Z,8Z,11Z,14Z,17Z)-icosapentaenoyl-CoA
 
** (5Z,8Z,11Z,14Z,17Z)-eicosapentaenoyl-CoA
 
** (5Z,8Z,11Z,14Z,17Z)-eicosa-5,8,11,14,17-pentaenoyl-CoA
 
** (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl-CoA
 
** eicosapentaenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-12978]]
+
** 1 [[CO-A]][c] '''+''' 1 [[LINOLENIC_ACID]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[PPI]][c] '''+''' 1 [[LINOLENOYL-COA]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 coenzyme A[c] '''+''' 1 α-linolenate[c] '''+''' 1 ATP[c] '''=>''' 1 AMP[c] '''+''' 1 diphosphate[c] '''+''' 1 α-linolenoyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00008500001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
* Gene: [[CHC_T00009428001]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
* Gene: [[CHC_T00009428001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
* Gene: [[CHC_T00008160001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
* Gene: [[CHC_T00008811001]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
* Gene: [[CHC_T00008811001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
== Pathways  ==
 +
* [[PWY-7724]], icosapentaenoate biosynthesis III (8-desaturase, mammals): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7724 PWY-7724]
 +
** '''2''' reactions found over '''7''' reactions in the full pathway
 +
* [[PWY-7049]], icosapentaenoate biosynthesis II (6-desaturase, mammals): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7049 PWY-7049]
 +
** '''2''' reactions found over '''7''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-original_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581014 71581014]
+
{{#set: common name=long-chain-fatty-acid-CoA ligase}}
* CHEBI:
+
{{#set: ec number=EC-6.2.1.3}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73862 73862]
+
{{#set: gene associated=CHC_T00008500001_1|CHC_T00009428001|CHC_T00009428001_1|CHC_T00008160001_1|CHC_T00008811001|CHC_T00008811001_1}}
{{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: in pathway=PWY-7724|PWY-7049}}
{{#set: inchi key=InChIKey=JWZLRYCDDXHXDL-LCMHIRPZSA-J}}
+
{{#set: reconstruction category=orthology|annotation}}
{{#set: common name=icosapentaenoyl-CoA}}
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria|annotation-original_genome|orthology-ectocarpus_siliculosus}}
{{#set: molecular weight=1047.943    }}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
{{#set: common name=(5Z,8Z,11Z,14Z,17Z)-icosapentaenoyl-CoA|(5Z,8Z,11Z,14Z,17Z)-eicosapentaenoyl-CoA|(5Z,8Z,11Z,14Z,17Z)-eicosa-5,8,11,14,17-pentaenoyl-CoA|(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl-CoA|eicosapentaenoyl-CoA}}
+
{{#set: produced by=RXN-12978}}
+

Latest revision as of 17:48, 9 January 2019

Reaction LINOLENOYL-RXN

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • long-chain-fatty-acid-CoA ligase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 coenzyme A[c] + 1 α-linolenate[c] + 1 ATP[c] => 1 AMP[c] + 1 diphosphate[c] + 1 α-linolenoyl-CoA[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7724, icosapentaenoate biosynthesis III (8-desaturase, mammals): PWY-7724
    • 2 reactions found over 7 reactions in the full pathway
  • PWY-7049, icosapentaenoate biosynthesis II (6-desaturase, mammals): PWY-7049
    • 2 reactions found over 7 reactions in the full pathway

Reconstruction information

External links