Difference between revisions of "ITACONATE"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00008726001 == * left end position: ** 333906 * transcription direction: ** NEGATIVE * right end position: ** 334708 * centisome position: ** 73...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ITACONATE ITACONATE] == |
| − | * | + | * smiles: |
| − | ** | + | ** C=C(C(=O)[O-])CC([O-])=O |
| − | * | + | * molecular weight: |
| − | ** | + | ** 128.084 |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=LVHBHZANLOWSRM-UHFFFAOYSA-L |
| − | * | + | * common name: |
| − | ** | + | ** itaconate |
* Synonym(s): | * Synonym(s): | ||
| + | ** propylenedicarboxylic acid | ||
| + | ** methylenebutanedioic acid | ||
| + | ** 2-propene-1,2-dicarboxylic acid | ||
| + | ** methylenesuccinic acid | ||
| + | ** itaconic acid | ||
| + | ** 2-methylsuccinate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-8988]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * METABOLIGHTS : MTBLC17240 |
| − | {{#set: | + | * CAS : 97-65-4 |
| − | {{#set: | + | * HMDB : HMDB02092 |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.4573697.html 4573697] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17240 17240] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00490 C00490] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459996 5459996] | ||
| + | {{#set: smiles=C=C(C(=O)[O-])CC([O-])=O}} | ||
| + | {{#set: molecular weight=128.084 }} | ||
| + | {{#set: inchi key=InChIKey=LVHBHZANLOWSRM-UHFFFAOYSA-L}} | ||
| + | {{#set: common name=itaconate}} | ||
| + | {{#set: common name=propylenedicarboxylic acid|methylenebutanedioic acid|2-propene-1,2-dicarboxylic acid|methylenesuccinic acid|itaconic acid|2-methylsuccinate}} | ||
| + | {{#set: consumed by=RXN-8988}} | ||
Latest revision as of 16:48, 9 January 2019
Contents
Metabolite ITACONATE
- smiles:
- C=C(C(=O)[O-])CC([O-])=O
- molecular weight:
- 128.084
- inchi key:
- InChIKey=LVHBHZANLOWSRM-UHFFFAOYSA-L
- common name:
- itaconate
- Synonym(s):
- propylenedicarboxylic acid
- methylenebutanedioic acid
- 2-propene-1,2-dicarboxylic acid
- methylenesuccinic acid
- itaconic acid
- 2-methylsuccinate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- METABOLIGHTS : MTBLC17240
- CAS : 97-65-4
- HMDB : HMDB02092
- CHEMSPIDER:
- CHEBI:
- LIGAND-CPD:
- PUBCHEM:
"C=C(C(=O)[O-])CC([O-])=O" cannot be used as a page name in this wiki.
