Difference between revisions of "IDP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1133 CPD0-1133] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O1)OC2(C(O)C(O)C(OC(CO)2)OC3(C(O)C(O)...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IDP IDP] == |
* smiles: | * smiles: | ||
| − | ** C( | + | ** C(OP(=O)([O-])OP([O-])(=O)[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23))) |
| + | * molecular weight: | ||
| + | ** 425.165 | ||
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=JPXZQMKKFWMMGK-KQYNXXCUSA-K |
* common name: | * common name: | ||
| − | ** | + | ** IDP |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** riboxin | ||
| + | ** inosine diphosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-14003]] |
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN0-5073]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-14120]] | ||
== External links == | == External links == | ||
| − | * | + | * METABOLIGHTS : MTBLC58280 |
| − | ** [http://www. | + | * BIGG : idp |
| + | * CAS : 86-04-4 | ||
| + | * HMDB : HMDB03335 | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.3279691.html 3279691] | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58280 58280] |
| − | * | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00104 C00104] | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7156952 7156952] |
| − | + | {{#set: smiles=C(OP(=O)([O-])OP([O-])(=O)[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23)))}} | |
| − | {{#set: smiles=C( | + | {{#set: molecular weight=425.165 }} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=JPXZQMKKFWMMGK-KQYNXXCUSA-K}} |
| − | {{#set: common name= | + | {{#set: common name=IDP}} |
| − | {{#set: | + | {{#set: common name=riboxin|inosine diphosphate}} |
| − | {{#set: consumed by=RXN- | + | {{#set: consumed by=RXN-14003}} |
| − | {{#set: produced by= | + | {{#set: produced by=RXN0-5073}} |
| + | {{#set: reversible reaction associated=RXN-14120}} | ||
Latest revision as of 16:48, 9 January 2019
Contents
Metabolite IDP
- smiles:
- C(OP(=O)([O-])OP([O-])(=O)[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23)))
- molecular weight:
- 425.165
- inchi key:
- InChIKey=JPXZQMKKFWMMGK-KQYNXXCUSA-K
- common name:
- IDP
- Synonym(s):
- riboxin
- inosine diphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- METABOLIGHTS : MTBLC58280
- BIGG : idp
- CAS : 86-04-4
- HMDB : HMDB03335
- CHEMSPIDER:
- CHEBI:
- LIGAND-CPD:
- PUBCHEM:
"C(OP(=O)([O-])OP([O-])(=O)[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23)))" cannot be used as a page name in this wiki.
