Difference between revisions of "CPD-5662"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00006498001_1 == * Synonym(s): == Reactions associated == * ASPAMINOTRANS-RXN ** pantograph-galdieria.sulphuraria * RXN-10814 *...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene CHC_T00006498001_1 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5662 CPD-5662] ==
 +
* smiles:
 +
** C(S)C1(C(NC(N1)=O)CCCCCC(=O)[O-])
 +
* molecular weight:
 +
** 245.316   
 +
* inchi key:
 +
** InChIKey=ZARFDBYKHCOTRH-UHFFFAOYSA-M
 +
* common name:
 +
** 9-mercaptodethiobiotin
 
* Synonym(s):
 
* Synonym(s):
 +
** 9-mercaptodesthiobiotin
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[ASPAMINOTRANS-RXN]]
+
* [[RXN-17473]]
** [[pantograph]]-[[galdieria.sulphuraria]]
+
== Reaction(s) known to produce the compound ==
* [[RXN-10814]]
+
* [[RXN-17472]]
** [[pantograph]]-[[galdieria.sulphuraria]]
+
== Reaction(s) of unknown directionality ==
* [[RXN-11737]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
* [[RXN-13697]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
== Pathways associated ==
+
* [[ASPARAGINE-DEG1-PWY-1]]
+
* [[PWY-6318]]
+
* [[PWY-7383]]
+
* [[ASPARTATE-DEG1-PWY]]
+
* [[PWY-6643]]
+
* [[PWY-6642]]
+
* [[PWY-6638]]
+
* [[ASPARTATESYN-PWY]]
+
* [[PWY-5913]]
+
* [[PWY-7117]]
+
* [[GLUTDEG-PWY]]
+
* [[PWY-7115]]
+
* [[MALATE-ASPARTATE-SHUTTLE-PWY]]
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=ASPAMINOTRANS-RXN|RXN-10814|RXN-11737|RXN-13697}}
+
* PUBCHEM:
{{#set: pathway associated=ASPARAGINE-DEG1-PWY-1|PWY-6318|PWY-7383|ASPARTATE-DEG1-PWY|PWY-6643|PWY-6642|PWY-6638|ASPARTATESYN-PWY|PWY-5913|PWY-7117|GLUTDEG-PWY|PWY-7115|MALATE-ASPARTATE-SHUTTLE-PWY}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244092 25244092]
 +
{{#set: smiles=C(S)C1(C(NC(N1)=O)CCCCCC(=O)[O-])}}
 +
{{#set: molecular weight=245.316    }}
 +
{{#set: inchi key=InChIKey=ZARFDBYKHCOTRH-UHFFFAOYSA-M}}
 +
{{#set: common name=9-mercaptodethiobiotin}}
 +
{{#set: common name=9-mercaptodesthiobiotin}}
 +
{{#set: consumed by=RXN-17473}}
 +
{{#set: produced by=RXN-17472}}

Latest revision as of 16:49, 9 January 2019

Metabolite CPD-5662

  • smiles:
    • C(S)C1(C(NC(N1)=O)CCCCCC(=O)[O-])
  • molecular weight:
    • 245.316
  • inchi key:
    • InChIKey=ZARFDBYKHCOTRH-UHFFFAOYSA-M
  • common name:
    • 9-mercaptodethiobiotin
  • Synonym(s):
    • 9-mercaptodesthiobiotin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(S)C1(C(NC(N1)=O)CCCCCC(=O)[O-])" cannot be used as a page name in this wiki.