Difference between revisions of "DUMP"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5754 PWY-5754] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUMP DUMP] == |
− | * | + | * smiles: |
− | ** [ | + | ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2)) |
+ | * molecular weight: | ||
+ | ** 306.168 | ||
+ | * inchi key: | ||
+ | ** InChIKey=JSRLJPSBLDHEIO-SHYZEUOFSA-L | ||
* common name: | * common name: | ||
− | ** | + | ** dUMP |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** deoxyurdine-phosphate |
+ | ** 2'-deoxyuridine 5-monophosphate | ||
+ | ** deoxyuridine-phosphate | ||
+ | ** 2'-deoxyuridine 5'-phosphate | ||
+ | ** 2'-deoxyuridylic acid | ||
+ | ** 2'-deoxy-5'-uridylic acid | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[THYMIDYLATESYN-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[DCMP-DEAMINASE-RXN]] | |
− | == Reaction(s) | + | * [[RXN-14220]] |
− | + | * [[RXN-14199]] | |
− | + | * [[DUTP-PYROP-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | * | + | |
== External links == | == External links == | ||
− | {{#set: | + | * METABOLIGHTS : MTBLC246422 |
− | {{#set: common name= | + | * BIGG : dump |
− | {{#set: common name= | + | * CAS : 964-26-1 |
− | {{#set: | + | * HMDB : HMDB01409 |
− | {{#set: | + | * CHEMSPIDER: |
+ | ** [http://www.chemspider.com/Chemical-Structure.18555972.html 18555972] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=246422 246422] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00365 C00365] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=18601100 18601100] | ||
+ | {{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2))}} | ||
+ | {{#set: molecular weight=306.168 }} | ||
+ | {{#set: inchi key=InChIKey=JSRLJPSBLDHEIO-SHYZEUOFSA-L}} | ||
+ | {{#set: common name=dUMP}} | ||
+ | {{#set: common name=deoxyurdine-phosphate|2'-deoxyuridine 5-monophosphate|deoxyuridine-phosphate|2'-deoxyuridine 5'-phosphate|2'-deoxyuridylic acid|2'-deoxy-5'-uridylic acid}} | ||
+ | {{#set: consumed by=THYMIDYLATESYN-RXN}} | ||
+ | {{#set: produced by=DCMP-DEAMINASE-RXN|RXN-14220|RXN-14199|DUTP-PYROP-RXN}} |
Latest revision as of 16:50, 9 January 2019
Contents
Metabolite DUMP
- smiles:
- C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2))
- molecular weight:
- 306.168
- inchi key:
- InChIKey=JSRLJPSBLDHEIO-SHYZEUOFSA-L
- common name:
- dUMP
- Synonym(s):
- deoxyurdine-phosphate
- 2'-deoxyuridine 5-monophosphate
- deoxyuridine-phosphate
- 2'-deoxyuridine 5'-phosphate
- 2'-deoxyuridylic acid
- 2'-deoxy-5'-uridylic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- METABOLIGHTS : MTBLC246422
- BIGG : dump
- CAS : 964-26-1
- HMDB : HMDB01409
- CHEMSPIDER:
- CHEBI:
- LIGAND-CPD:
- PUBCHEM:
"C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2))" cannot be used as a page name in this wiki.