Difference between revisions of "MPBQ"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MPBQ MPBQ] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(O)C=C(C)C(O)=1))C)C * inchi key: **...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(O)C=C(C)C(O)=1))C)C | ** CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(O)C=C(C)C(O)=1))C)C | ||
| + | * molecular weight: | ||
| + | ** 402.659 | ||
* inchi key: | * inchi key: | ||
** InChIKey=GTWCNYRFOZKWTL-UOFXASEASA-N | ** InChIKey=GTWCNYRFOZKWTL-UOFXASEASA-N | ||
* common name: | * common name: | ||
** 2-methyl-6-phytyl-1,4-benzoquinol | ** 2-methyl-6-phytyl-1,4-benzoquinol | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
| Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75920 75920] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75920 75920] | ||
| Line 24: | Line 22: | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71768135 71768135] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71768135 71768135] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C15882 C15882] | ||
* HMDB : HMDB38959 | * HMDB : HMDB38959 | ||
{{#set: smiles=CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(O)C=C(C)C(O)=1))C)C}} | {{#set: smiles=CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(O)C=C(C)C(O)=1))C)C}} | ||
| + | {{#set: molecular weight=402.659 }} | ||
{{#set: inchi key=InChIKey=GTWCNYRFOZKWTL-UOFXASEASA-N}} | {{#set: inchi key=InChIKey=GTWCNYRFOZKWTL-UOFXASEASA-N}} | ||
{{#set: common name=2-methyl-6-phytyl-1,4-benzoquinol}} | {{#set: common name=2-methyl-6-phytyl-1,4-benzoquinol}} | ||
| − | |||
{{#set: consumed by=RXN-2542}} | {{#set: consumed by=RXN-2542}} | ||
{{#set: produced by=RXN-2541}} | {{#set: produced by=RXN-2541}} | ||
Latest revision as of 16:52, 9 January 2019
Contents
Metabolite MPBQ
- smiles:
- CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(O)C=C(C)C(O)=1))C)C
- molecular weight:
- 402.659
- inchi key:
- InChIKey=GTWCNYRFOZKWTL-UOFXASEASA-N
- common name:
- 2-methyl-6-phytyl-1,4-benzoquinol
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
