Difference between revisions of "PWY-5754"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-FORMYLKYNURENINE N-FORMYLKYNURENINE] == * smiles: ** [CH](=O)NC1(C=CC=CC=1C(=O)CC([N+])C(=O)[...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-FORMYLKYNURENINE N-FORMYLKYNURENINE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5754 PWY-5754] ==
* smiles:
+
** [CH](=O)NC1(C=CC=CC=1C(=O)CC([N+])C(=O)[O-])
+
* inchi key:
+
** InChIKey=BYHJHXPTQMMKCA-QMMMGPOBSA-N
+
 
* common name:
 
* common name:
** N-formylkynurenine
+
** 4-hydroxybenzoate biosynthesis I (eukaryotes)
* molecular weight:
+
* taxonomic range:
** 236.227   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
 
* Synonym(s):
 
* Synonym(s):
** N-Formyl-L-kynurenine
+
** p-hydroxybenzoate biosynthesis I (eukaryotes)
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''2''' reactions found over '''6''' reactions in the full pathway
* [[RXN-8665]]
+
* [[4-COUMARATE--COA-LIGASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
 +
*** [[CHC_T00008160001_1]]
 +
*** [[CHC_T00008472001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[TYROSINE-AMINOTRANSFERASE-RXN]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00008863001_1]]
 +
*** [[CHC_T00008863001]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=3.1.2.23-RXN 3.1.2.23-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=HYDROXYPHENYLPYRUVATE-REDUCTASE-RXN HYDROXYPHENYLPYRUVATE-REDUCTASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-1118 RXN3O-1118]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-1120 RXN3O-1120]
 
== External links  ==
 
== External links  ==
* CAS : 1022-31-7
+
{{#set: common name=4-hydroxybenzoate biosynthesis I (eukaryotes)}}
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2759}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202092 25202092]
+
{{#set: common name=p-hydroxybenzoate biosynthesis I (eukaryotes)}}
* CHEBI:
+
{{#set: reaction found=2}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58629 58629]
+
{{#set: total reaction=6}}
* LIGAND-CPD:
+
{{#set: completion rate=33.0}}
** [http://www.genome.jp/dbget-bin/www_bget?C02700 C02700]
+
* HMDB : HMDB60485
+
{{#set: smiles=[CH](=O)NC1(C=CC=CC=1C(=O)CC([N+])C(=O)[O-])}}
+
{{#set: inchi key=InChIKey=BYHJHXPTQMMKCA-QMMMGPOBSA-N}}
+
{{#set: common name=N-formylkynurenine}}
+
{{#set: molecular weight=236.227    }}
+
{{#set: common name=N-Formyl-L-kynurenine}}
+
{{#set: produced by=RXN-8665}}
+

Latest revision as of 16:52, 9 January 2019

Pathway PWY-5754

  • common name:
    • 4-hydroxybenzoate biosynthesis I (eukaryotes)
  • taxonomic range:
  • Synonym(s):
    • p-hydroxybenzoate biosynthesis I (eukaryotes)

Reaction(s) found

2 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links