Difference between revisions of "CPD66-28"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00008037001_1 == * Synonym(s): == Reactions associated == * FRUCTOKINASE-RXN ** pantograph-galdieria.sulphuraria == Pathways associ...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-28 CPD66-28] == |
| + | * smiles: | ||
| + | ** CC(=O)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34)))) | ||
| + | * molecular weight: | ||
| + | ** 314.467 | ||
| + | * inchi key: | ||
| + | ** InChIKey=MNRHZPCIEGLWGK-LEKSSAKUSA-N | ||
| + | * common name: | ||
| + | ** pregn-5-ene-3,20-dione | ||
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN66-353]] | |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63837 63837] |
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=150901 150901] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.546029.html 546029] | ||
| + | {{#set: smiles=CC(=O)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}} | ||
| + | {{#set: molecular weight=314.467 }} | ||
| + | {{#set: inchi key=InChIKey=MNRHZPCIEGLWGK-LEKSSAKUSA-N}} | ||
| + | {{#set: common name=pregn-5-ene-3,20-dione}} | ||
| + | {{#set: produced by=RXN66-353}} | ||
Latest revision as of 16:53, 9 January 2019
Contents
Metabolite CPD66-28
- smiles:
- CC(=O)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
- molecular weight:
- 314.467
- inchi key:
- InChIKey=MNRHZPCIEGLWGK-LEKSSAKUSA-N
- common name:
- pregn-5-ene-3,20-dione
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=O)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.
