Difference between revisions of "CPD0-1133"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-Oxo-carboxylates 2-Oxo-carboxylates] == * common name: ** a 2-oxo carboxylate * Synonym(s): *...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1133 CPD0-1133] == |
+ | * smiles: | ||
+ | ** C(O)C1(C(O)C(O)C(O)C(O1)OC2(C(O)C(O)C(OC(CO)2)OC3(C(O)C(O)C(OC(CO)3)OC7(C(O)C(O)C(OC6(C(O)C(O)C(OC4(C(O)C(O)C(OC(CO)4)OC5(C(O)C(O)C(O)OC(CO)5)))OC(CO)6))OC(CO)7)))) | ||
+ | * molecular weight: | ||
+ | ** 1153.009 | ||
+ | * inchi key: | ||
+ | ** InChIKey=BNABBHGYYMZMOA-QJBBZCPBSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** maltoheptaose |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-14283]] | ||
+ | * [[RXN-14286]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[MALTODEG-RXN]] |
− | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | {{#set: | + | * CHEBI: |
− | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61954 61954] |
− | {{#set: | + | * METABOLIGHTS : MTBLC61954 |
− | {{#set: | + | * BIGG : malthp |
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=13908996 13908996] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?G00689 G00689] | ||
+ | {{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O1)OC2(C(O)C(O)C(OC(CO)2)OC3(C(O)C(O)C(OC(CO)3)OC7(C(O)C(O)C(OC6(C(O)C(O)C(OC4(C(O)C(O)C(OC(CO)4)OC5(C(O)C(O)C(O)OC(CO)5)))OC(CO)6))OC(CO)7))))}} | ||
+ | {{#set: molecular weight=1153.009 }} | ||
+ | {{#set: inchi key=InChIKey=BNABBHGYYMZMOA-QJBBZCPBSA-N}} | ||
+ | {{#set: common name=maltoheptaose}} | ||
+ | {{#set: consumed by=RXN-14283|RXN-14286}} | ||
+ | {{#set: produced by=MALTODEG-RXN}} |
Latest revision as of 16:53, 9 January 2019
Contents
Metabolite CPD0-1133
- smiles:
- C(O)C1(C(O)C(O)C(O)C(O1)OC2(C(O)C(O)C(OC(CO)2)OC3(C(O)C(O)C(OC(CO)3)OC7(C(O)C(O)C(OC6(C(O)C(O)C(OC4(C(O)C(O)C(OC(CO)4)OC5(C(O)C(O)C(O)OC(CO)5)))OC(CO)6))OC(CO)7))))
- molecular weight:
- 1153.009
- inchi key:
- InChIKey=BNABBHGYYMZMOA-QJBBZCPBSA-N
- common name:
- maltoheptaose
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links