Difference between revisions of "CPD-294"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FPPSYN-RXN FPPSYN-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/E...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=FPPSYN-RXN FPPSYN-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-294 CPD-294] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C(=CC(=O)[O-])C(=O)CC([O-])=O
* ec number:
+
* molecular weight:
** [http://enzyme.expasy.org/EC/2.5.1.10 EC-2.5.1.10]
+
** 156.095   
 +
* inchi key:
 +
** InChIKey=SOXXPQLIZIPMIZ-UPHRSURJSA-L
 +
* common name:
 +
** 2-maleylacetate
 
* Synonym(s):
 
* Synonym(s):
 +
** 4-oxohex-2-enedioate
 +
** maleylacetate
 +
** (2Z)-4-oxohex-2-enedioate
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[DELTA3-ISOPENTENYL-PP]][c] '''+''' 1 [[GERANYL-PP]][c] '''=>''' 1 [[FARNESYL-PP]][c] '''+''' 1 [[PPI]][c]
+
* [[RXN-9868]]
* With common name(s):
+
* [[CARBOXYMETHYLENEBUTENOLIDASE-RXN]]
** 1 isopentenyl diphosphate[c] '''+''' 1 geranyl diphosphate[c] '''=>''' 1 (2E,6E)-farnesyl diphosphate[c] '''+''' 1 diphosphate[c]
+
== Reaction(s) of unknown directionality ==
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[CHC_T00006851001_1]]
+
** [[pantograph]]-[[a.taliana]]
+
* [[CHC_T00002324001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
== Pathways  ==
+
* [[PWY-7736]], stellatic acid biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7736 PWY-7736]
+
** '''3''' reactions found over '''8''' reactions in the full pathway
+
* [[PWY-6859]], all-trans-farnesol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6859 PWY-6859]
+
** '''3''' reactions found over '''4''' reactions in the full pathway
+
* [[PWY-5123]], trans, trans-farnesyl diphosphate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5123 PWY-5123]
+
** '''3''' reactions found over '''3''' reactions in the full pathway
+
* [[PWY-7721]], methyl phomopsenoate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7721 PWY-7721]
+
** '''2''' reactions found over '''4''' reactions in the full pathway
+
* [[PWY-7102]], bisabolene biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7102 PWY-7102]
+
** '''3''' reactions found over '''6''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[galdieria.sulphuraria]]
+
*** [[a.taliana]]
+
 
== External links  ==
 
== External links  ==
* RHEA:
+
* CHEBI:
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=19361 19361]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16468 16468]
* LIGAND-RXN:
+
* PUBCHEM:
** [http://www.genome.jp/dbget-bin/www_bget?R02003 R02003]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9543165 9543165]
* UNIPROT:
+
* LIGAND-CPD:
** [http://www.uniprot.org/uniprot/P08524 P08524]
+
** [http://www.genome.jp/dbget-bin/www_bget?C02222 C02222]
** [http://www.uniprot.org/uniprot/P05369 P05369]
+
* UM-BBD-CPD : c0099
** [http://www.uniprot.org/uniprot/P14324 P14324]
+
* CHEMSPIDER:
** [http://www.uniprot.org/uniprot/Q9CH81 Q9CH81]
+
** [http://www.chemspider.com/Chemical-Structure.7822138.html 7822138]
** [http://www.uniprot.org/uniprot/Q9PM32 Q9PM32]
+
{{#set: smiles=C(=CC(=O)[O-])C(=O)CC([O-])=O}}
** [http://www.uniprot.org/uniprot/P45204 P45204]
+
{{#set: molecular weight=156.095    }}
** [http://www.uniprot.org/uniprot/Q9JSM0 Q9JSM0]
+
{{#set: inchi key=InChIKey=SOXXPQLIZIPMIZ-UPHRSURJSA-L}}
** [http://www.uniprot.org/uniprot/P49350 P49350]
+
{{#set: common name=2-maleylacetate}}
** [http://www.uniprot.org/uniprot/P22939 P22939]
+
{{#set: common name=4-oxohex-2-enedioate|maleylacetate|(2Z)-4-oxohex-2-enedioate}}
** [http://www.uniprot.org/uniprot/Q08291 Q08291]
+
{{#set: produced by=RXN-9868|CARBOXYMETHYLENEBUTENOLIDASE-RXN}}
** [http://www.uniprot.org/uniprot/P49349 P49349]
+
** [http://www.uniprot.org/uniprot/Q09152 Q09152]
+
** [http://www.uniprot.org/uniprot/P49351 P49351]
+
** [http://www.uniprot.org/uniprot/P49352 P49352]
+
** [http://www.uniprot.org/uniprot/Q43315 Q43315]
+
** [http://www.uniprot.org/uniprot/O24241 O24241]
+
** [http://www.uniprot.org/uniprot/O24242 O24242]
+
** [http://www.uniprot.org/uniprot/Q92334 Q92334]
+
** [http://www.uniprot.org/uniprot/Q92218 Q92218]
+
** [http://www.uniprot.org/uniprot/Q92235 Q92235]
+
** [http://www.uniprot.org/uniprot/Q92250 Q92250]
+
** [http://www.uniprot.org/uniprot/Q8L7F4 Q8L7F4]
+
** [http://www.uniprot.org/uniprot/P49353 P49353]
+
** [http://www.uniprot.org/uniprot/O04882 O04882]
+
** [http://www.uniprot.org/uniprot/O65004 O65004]
+
** [http://www.uniprot.org/uniprot/O14230 O14230]
+
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: ec number=EC-2.5.1.10}}
+
{{#set: gene associated=CHC_T00006851001_1|CHC_T00002324001_1}}
+
{{#set: in pathway=PWY-7736|PWY-6859|PWY-5123|PWY-7721|PWY-7102}}
+
{{#set: reconstruction category=orthology}}
+
{{#set: reconstruction tool=pantograph}}
+
{{#set: reconstruction source=galdieria.sulphuraria|a.taliana}}
+

Latest revision as of 16:54, 9 January 2019

Metabolite CPD-294

  • smiles:
    • C(=CC(=O)[O-])C(=O)CC([O-])=O
  • molecular weight:
    • 156.095
  • inchi key:
    • InChIKey=SOXXPQLIZIPMIZ-UPHRSURJSA-L
  • common name:
    • 2-maleylacetate
  • Synonym(s):
    • 4-oxohex-2-enedioate
    • maleylacetate
    • (2Z)-4-oxohex-2-enedioate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=CC(=O)[O-])C(=O)CC([O-])=O" cannot be used as a page name in this wiki.