Difference between revisions of "RXN-17573"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18 CPD-18] == * smiles: ** CCCCCC=CCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18 CPD-18] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17573 RXN-17573] ==
* smiles:
+
* direction:
** CCCCCC=CCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=YECLLIMZHNYFCK-RRNJGNTNSA-J
+
** [http://enzyme.expasy.org/EC/2.5.1.58 EC-2.5.1.58]
* common name:
+
** linoleoyl-CoA
+
* molecular weight:
+
** 1025.937   
+
 
* Synonym(s):
 
* Synonym(s):
** cis,cis-octadeca-9,12-dienoyl-CoA
 
** (9Z,12Z)-octadeca-9,12-dienoyl-CoA
 
** 18:2(n-6)
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-9673]]
+
** 1 [[CAAX-proteins]][c] '''+''' 1 [[FARNESYL-PP]][c] '''=>''' 1 [[Farnesylated-CAAX-proteins]][c] '''+''' 1 [[PPI]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a protein that ends with a CAAX sequence[c] '''+''' 1 (2E,6E)-farnesyl diphosphate[c] '''=>''' 1 a farnesylated protein that ends with a CAAX sequence[c] '''+''' 1 diphosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00003240001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
* Gene: [[CHC_T00003446001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245440 25245440]
+
{{#set: ec number=EC-2.5.1.58}}
* CHEBI:
+
{{#set: gene associated=CHC_T00003240001_1|CHC_T00003446001_1}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57383 57383]
+
{{#set: in pathway=}}
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
** [http://www.genome.jp/dbget-bin/www_bget?C02050 C02050]
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria|orthology-ectocarpus_siliculosus}}
* HMDB : HMDB01064
+
{{#set: reconstruction tool=pantograph}}
{{#set: smiles=CCCCCC=CCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=YECLLIMZHNYFCK-RRNJGNTNSA-J}}
+
{{#set: common name=linoleoyl-CoA}}
+
{{#set: molecular weight=1025.937    }}
+
{{#set: common name=cis,cis-octadeca-9,12-dienoyl-CoA|(9Z,12Z)-octadeca-9,12-dienoyl-CoA|18:2(n-6)}}
+
{{#set: produced by=RXN-9673}}
+

Latest revision as of 17:54, 9 January 2019

Reaction RXN-17573

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 a protein that ends with a CAAX sequence[c] + 1 (2E,6E)-farnesyl diphosphate[c] => 1 a farnesylated protein that ends with a CAAX sequence[c] + 1 diphosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links