Difference between revisions of "RXN-13677"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXAMINE PYRIDOXAMINE] == * smiles: ** CC1(=NC=C(CO)C(C[N+])=C(O)1) * inchi key: ** InChIKe...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXAMINE PYRIDOXAMINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13677 RXN-13677] ==
* smiles:
+
* direction:
** CC1(=NC=C(CO)C(C[N+])=C(O)1)
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=NHZMQXZHNVQTQA-UHFFFAOYSA-O
+
** [http://enzyme.expasy.org/EC/3.4.11.2 EC-3.4.11.2]
* common name:
+
** pyridoxamine
+
* molecular weight:
+
** 169.203   
+
 
* Synonym(s):
 
* Synonym(s):
** PM
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[PYRAMKIN-RXN]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[WATER]][c] '''+''' 1 [[CPD-14705]][c] '''=>''' 1 [[CPD-14706]][c] '''+''' 1 [[GLY]][c]
* [[RXN-14046]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 H2O[c] '''+''' 1 4-hydroxy-2-nonenal-[Cys-Gly] conjugate[c] '''=>''' 1 4-hydroxy-2-nonenal-[L-Cys] conjugate[c] '''+''' 1 glycine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00002549001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
== Pathways  ==
 +
* [[PWY-7112]], 4-hydroxy-2-nonenal detoxification: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7112 PWY-7112]
 +
** '''2''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* CAS : 85-87-0
+
{{#set: direction=LEFT-TO-RIGHT}}
* METABOLIGHTS : MTBLC57761
+
{{#set: ec number=EC-3.4.11.2}}
* PUBCHEM:
+
{{#set: gene associated=CHC_T00002549001_1}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245492 25245492]
+
{{#set: in pathway=PWY-7112}}
* HMDB : HMDB01431
+
{{#set: reconstruction category=orthology}}
* LIGAND-CPD:
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria|orthology-ectocarpus_siliculosus}}
** [http://www.genome.jp/dbget-bin/www_bget?C00534 C00534]
+
{{#set: reconstruction tool=pantograph}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57761 57761]
+
* BIGG : pydam
+
{{#set: smiles=CC1(=NC=C(CO)C(C[N+])=C(O)1)}}
+
{{#set: inchi key=InChIKey=NHZMQXZHNVQTQA-UHFFFAOYSA-O}}
+
{{#set: common name=pyridoxamine}}
+
{{#set: molecular weight=169.203    }}
+
{{#set: common name=PM}}
+
{{#set: consumed by=PYRAMKIN-RXN}}
+
{{#set: produced by=RXN-14046}}
+

Latest revision as of 16:55, 9 January 2019

Reaction RXN-13677

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H2O[c] + 1 4-hydroxy-2-nonenal-[Cys-Gly] conjugate[c] => 1 4-hydroxy-2-nonenal-[L-Cys] conjugate[c] + 1 glycine[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7112, 4-hydroxy-2-nonenal detoxification: PWY-7112
    • 2 reactions found over 4 reactions in the full pathway

Reconstruction information

External links