Difference between revisions of "CPD-513"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00008655001 == * left end position: ** 103829 * transcription direction: ** POSITIVE * right end position: ** 107458 * centisome position: ** 31...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene CHC_T00008655001 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-513 CPD-513] ==
* left end position:
+
* smiles:
** 103829
+
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(O)C1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
* transcription direction:
+
* molecular weight:
** POSITIVE
+
** 911.663   
* right end position:
+
* inchi key:
** 107458
+
** InChIKey=AAZZVFONLHYNDZ-NVQRUNIKSA-J
* centisome position:
+
* common name:
** 31.667057   
+
** 3-hydroxy-3-phenylpropanoyl-CoA
 
* Synonym(s):
 
* Synonym(s):
 +
** hydroxycinnamoyl-CoA (ambiguous)
 +
** β-hydroxyphenyl-propionyl-CoA
 +
** 3-hydroxy-3-phenylpropionyl-coenzyme A
 +
** 3-hydroxy-3-phenylpropionyl-CoA
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[3.2.1.24-RXN]]
+
* [[RXN-11278]]
** original_genome
+
== Reaction(s) known to produce the compound ==
***automated-name-match
+
* [[RXN-2002]]
* [[RXN0-5216]]
+
== Reaction(s) of unknown directionality ==
** original_genome
+
***automated-name-match
+
== Pathways associated ==
+
* [[PWY0-1300]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=103829}}
+
* CHEBI:
{{#set: transcription direction=POSITIVE}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71294 71294]
{{#set: right end position=107458}}
+
* PUBCHEM:
{{#set: centisome position=31.667057    }}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70680322 70680322]
{{#set: reaction associated=3.2.1.24-RXN|RXN0-5216}}
+
* LIGAND-CPD:
{{#set: pathway associated=PWY0-1300}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C06362 C06362]
 +
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(O)C1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
 +
{{#set: molecular weight=911.663    }}
 +
{{#set: inchi key=InChIKey=AAZZVFONLHYNDZ-NVQRUNIKSA-J}}
 +
{{#set: common name=3-hydroxy-3-phenylpropanoyl-CoA}}
 +
{{#set: common name=hydroxycinnamoyl-CoA (ambiguous)|β-hydroxyphenyl-propionyl-CoA|3-hydroxy-3-phenylpropionyl-coenzyme A|3-hydroxy-3-phenylpropionyl-CoA}}
 +
{{#set: consumed by=RXN-11278}}
 +
{{#set: produced by=RXN-2002}}

Latest revision as of 16:55, 9 January 2019

Metabolite CPD-513

  • smiles:
    • CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(O)C1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
  • molecular weight:
    • 911.663
  • inchi key:
    • InChIKey=AAZZVFONLHYNDZ-NVQRUNIKSA-J
  • common name:
    • 3-hydroxy-3-phenylpropanoyl-CoA
  • Synonym(s):
    • hydroxycinnamoyl-CoA (ambiguous)
    • β-hydroxyphenyl-propionyl-CoA
    • 3-hydroxy-3-phenylpropionyl-coenzyme A
    • 3-hydroxy-3-phenylpropionyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(O)C1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-" cannot be used as a page name in this wiki.