Difference between revisions of "PWY-7316"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19153 CPD-19153] == * smiles: ** CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19153 CPD-19153] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7316 PWY-7316] ==
* smiles:
+
** CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=VKLHSLOWDWGVGP-CGGPSVLLSA-J
+
 
* common name:
 
* common name:
** 3-oxo-(5Z)-dodecenoyl-CoA
+
** dTDP-N-acetylviosamine biosynthesis
* molecular weight:
+
* taxonomic range:
** 957.775   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* Synonym(s):
 
* Synonym(s):
** 3-oxo-12:1-Δ5-CoA
+
** dTDP-4-acetamido-4,6-dideoxy-α-D-glucose biosynthesis
** 3-oxo-5-cis-dodecenoyl-CoA
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-17799]]
+
'''1''' reactions found over '''4''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[DTDPGLUCDEHYDRAT-RXN]]
* [[RXN-17798]]
+
** 4 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[CHC_T00009237001_1]]
 +
*** [[CHC_T00009237001]]
 +
*** [[CHC_T00008950001_1]]
 +
*** [[CHC_T00008912001_1]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=2.6.1.33-RXN 2.6.1.33-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=DTDPGLUCOSEPP-RXN DTDPGLUCOSEPP-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13755 RXN-13755]
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: common name=dTDP-N-acetylviosamine biosynthesis}}
{{#set: inchi key=InChIKey=VKLHSLOWDWGVGP-CGGPSVLLSA-J}}
+
{{#set: taxonomic range=TAX-2}}
{{#set: common name=3-oxo-(5Z)-dodecenoyl-CoA}}
+
{{#set: common name=dTDP-4-acetamido-4,6-dideoxy-α-D-glucose biosynthesis}}
{{#set: molecular weight=957.775    }}
+
{{#set: reaction found=1}}
{{#set: common name=3-oxo-12:1-Δ5-CoA|3-oxo-5-cis-dodecenoyl-CoA}}
+
{{#set: total reaction=4}}
{{#set: consumed by=RXN-17799}}
+
{{#set: completion rate=25.0}}
{{#set: produced by=RXN-17798}}
+

Latest revision as of 16:55, 9 January 2019

Pathway PWY-7316

  • common name:
    • dTDP-N-acetylviosamine biosynthesis
  • taxonomic range:
  • Synonym(s):
    • dTDP-4-acetamido-4,6-dideoxy-α-D-glucose biosynthesis

Reaction(s) found

1 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links