Difference between revisions of "CPD-4702"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00008782001_1 == * Synonym(s): == Reactions associated == * PROTEIN-KINASE-RXN ** pantograph-galdieria.sulphuraria == Pathways asso...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4702 CPD-4702] == |
+ | * smiles: | ||
+ | ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)1C=2CCC(C)34)))) | ||
+ | * molecular weight: | ||
+ | ** 427.646 | ||
+ | * inchi key: | ||
+ | ** InChIKey=JHIWIFRQJXLNEU-GSQAGGHASA-M | ||
+ | * common name: | ||
+ | ** 4α-carboxy-5α-cholesta-8,24-dien-3β-ol | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN66-318]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | * [[RXN-13709]] |
+ | * [[RXN66-317]] | ||
+ | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659076 90659076] | ||
+ | {{#set: smiles=CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)1C=2CCC(C)34))))}} | ||
+ | {{#set: molecular weight=427.646 }} | ||
+ | {{#set: inchi key=InChIKey=JHIWIFRQJXLNEU-GSQAGGHASA-M}} | ||
+ | {{#set: common name=4α-carboxy-5α-cholesta-8,24-dien-3β-ol}} | ||
+ | {{#set: consumed by=RXN66-318}} | ||
+ | {{#set: produced by=RXN-13709|RXN66-317}} |
Latest revision as of 16:57, 9 January 2019
Contents
Metabolite CPD-4702
- smiles:
- CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)1C=2CCC(C)34))))
- molecular weight:
- 427.646
- inchi key:
- InChIKey=JHIWIFRQJXLNEU-GSQAGGHASA-M
- common name:
- 4α-carboxy-5α-cholesta-8,24-dien-3β-ol
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.