Difference between revisions of "CPD-4702"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00008782001_1 == * Synonym(s): == Reactions associated == * PROTEIN-KINASE-RXN ** pantograph-galdieria.sulphuraria == Pathways asso...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene CHC_T00008782001_1 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4702 CPD-4702] ==
 +
* smiles:
 +
** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)1C=2CCC(C)34))))
 +
* molecular weight:
 +
** 427.646   
 +
* inchi key:
 +
** InChIKey=JHIWIFRQJXLNEU-GSQAGGHASA-M
 +
* common name:
 +
** 4α-carboxy-5α-cholesta-8,24-dien-3β-ol
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[PROTEIN-KINASE-RXN]]
+
* [[RXN66-318]]
** [[pantograph]]-[[galdieria.sulphuraria]]
+
== Reaction(s) known to produce the compound ==
== Pathways associated ==
+
* [[RXN-13709]]
 +
* [[RXN66-317]]
 +
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659076 90659076]
 +
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)1C=2CCC(C)34))))}}
 +
{{#set: molecular weight=427.646    }}
 +
{{#set: inchi key=InChIKey=JHIWIFRQJXLNEU-GSQAGGHASA-M}}
 +
{{#set: common name=4α-carboxy-5α-cholesta-8,24-dien-3β-ol}}
 +
{{#set: consumed by=RXN66-318}}
 +
{{#set: produced by=RXN-13709|RXN66-317}}

Latest revision as of 17:57, 9 January 2019

Metabolite CPD-4702

  • smiles:
    • CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)1C=2CCC(C)34))))
  • molecular weight:
    • 427.646
  • inchi key:
    • InChIKey=JHIWIFRQJXLNEU-GSQAGGHASA-M
  • common name:
    • 4α-carboxy-5α-cholesta-8,24-dien-3β-ol
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.