Difference between revisions of "CPD-602"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3R-7Z-3-hydroxy-hexadec-7-enoyl-ACPs 3R-7Z-3-hydroxy-hexadec-7-enoyl-ACPs] == * common name: **...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-602 CPD-602] == |
+ | * smiles: | ||
+ | ** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)NC2(=C(N)C(=O)NC(=O)N2)) | ||
+ | * molecular weight: | ||
+ | ** 352.197 | ||
+ | * inchi key: | ||
+ | ** InChIKey=LZEXYCAGPMYXLX-UMMCILCDSA-L | ||
* common name: | * common name: | ||
− | ** | + | ** 5-amino-6-(5-phospho-D-ribosylamino)uracil |
* Synonym(s): | * Synonym(s): | ||
+ | ** 5-amino-6-(ribosylamino)-2,4-(1H,3H)-pyrimidinedione 5'-phosphate | ||
+ | ** 5-amino-6-(5'-phosphoribosylamino)uracil | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RIBOFLAVINSYNREDUC-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RIBOFLAVINSYNDEAM-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * CHEBI: |
− | {{#set: consumed by= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58453 58453] |
− | {{#set: produced by= | + | * BIGG : 5apru |
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245199 25245199] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01268 C01268] | ||
+ | {{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)NC2(=C(N)C(=O)NC(=O)N2))}} | ||
+ | {{#set: molecular weight=352.197 }} | ||
+ | {{#set: inchi key=InChIKey=LZEXYCAGPMYXLX-UMMCILCDSA-L}} | ||
+ | {{#set: common name=5-amino-6-(5-phospho-D-ribosylamino)uracil}} | ||
+ | {{#set: common name=5-amino-6-(ribosylamino)-2,4-(1H,3H)-pyrimidinedione 5'-phosphate|5-amino-6-(5'-phosphoribosylamino)uracil}} | ||
+ | {{#set: consumed by=RIBOFLAVINSYNREDUC-RXN}} | ||
+ | {{#set: produced by=RIBOFLAVINSYNDEAM-RXN}} |
Latest revision as of 17:57, 9 January 2019
Contents
Metabolite CPD-602
- smiles:
- C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)NC2(=C(N)C(=O)NC(=O)N2))
- molecular weight:
- 352.197
- inchi key:
- InChIKey=LZEXYCAGPMYXLX-UMMCILCDSA-L
- common name:
- 5-amino-6-(5-phospho-D-ribosylamino)uracil
- Synonym(s):
- 5-amino-6-(ribosylamino)-2,4-(1H,3H)-pyrimidinedione 5'-phosphate
- 5-amino-6-(5'-phosphoribosylamino)uracil
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)NC2(=C(N)C(=O)NC(=O)N2))" cannot be used as a page name in this wiki.