Difference between revisions of "GLYMALTOPHOSPHORYL-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-469 CPD-469] == * smiles: ** CC(=O)NC(C([O-])=O)CC[CH]=O * inchi key: ** InChIKey=BCPSFKBPH...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYMALTOPHOSPHORYL-RXN GLYMALTOPHOSPHORYL-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Starch phosphorylase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.4.1.1 EC-2.4.1.1] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | == | + | ** 1 [[Glycogens]][c] '''+''' 1 [[Pi]][c] '''<=>''' 1 [[MALTOTETRAOSE]][c] '''+''' 1 [[GLC-1-P]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 a glycogen[c] '''+''' 1 phosphate[c] '''<=>''' 1 maltotetraose[c] '''+''' 1 α-D-glucopyranose 1-phosphate[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[CHC_T00008988001]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[CHC_T00008988001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=REVERSIBLE}} | |
− | + | {{#set: common name=Starch phosphorylase}} | |
− | + | {{#set: ec number=EC-2.4.1.1}} | |
− | + | {{#set: gene associated=CHC_T00008988001|CHC_T00008988001_1}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=orthology|annotation}} | |
− | + | {{#set: reconstruction source=orthology-galdieria.sulphuraria|annotation-original_genome}} | |
− | + | {{#set: reconstruction tool=pantograph|pathwaytools}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 16:58, 9 January 2019
Contents
Reaction GLYMALTOPHOSPHORYL-RXN
- direction:
- REVERSIBLE
- common name:
- Starch phosphorylase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Glycogens[c] + 1 Pi[c] <=> 1 MALTOTETRAOSE[c] + 1 GLC-1-P[c]
- With common name(s):
- 1 a glycogen[c] + 1 phosphate[c] <=> 1 maltotetraose[c] + 1 α-D-glucopyranose 1-phosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00008988001
- Source: annotation-original_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-original_genome
- Gene: CHC_T00008988001_1
- Source: orthology-galdieria.sulphuraria
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-galdieria.sulphuraria
- Tool: pantograph
- Source: orthology-galdieria.sulphuraria
- Category: annotation
- Source: annotation-original_genome
- Tool: pathwaytools
- Source: annotation-original_genome