Difference between revisions of "R-2-HYDROXYSTEARATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CIS-ACONITATE CIS-ACONITATE] == * smiles: ** C([O-])(=O)C(=CC(=O)[O-])CC(=O)[O-] * inchi key: *...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=R-2-HYDROXYSTEARATE R-2-HYDROXYSTEARATE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CCCCCCCCCCCCCCCCC(O)C(=O)[O-] |
| + | * molecular weight: | ||
| + | ** 299.473 | ||
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=KIHBGTRZFAVZRV-QGZVFWFLSA-M |
* common name: | * common name: | ||
| − | ** | + | ** (R)-2-hydroxystearate |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN66-474-R-2-HYDROXYSTEARATE/ATP/CO-A//CPD-14717/AMP/PPI.48.]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-11820-STEARIC_ACID/HYDROGEN-PEROXIDE//R-2-HYDROXYSTEARATE/WATER.58.]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[ACECOATRANS-RXN-CPD-14717/ACET//R-2-HYDROXYSTEARATE/ACETYL-COA.47.]] |
| − | + | ||
== External links == | == External links == | ||
| − | * CAS : | + | * CAS : 629-22-1 |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* CHEMSPIDER: | * CHEMSPIDER: | ||
| − | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.13600149.html 13600149] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57562 57562] |
| − | * | + | * LIGAND-CPD: |
| − | {{#set: smiles= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03042 C03042] |
| − | {{#set: inchi key=InChIKey= | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21145040 21145040] |
| − | {{#set: | + | * NCI: |
| − | {{#set: | + | ** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=907 907] |
| − | {{#set: | + | {{#set: smiles=CCCCCCCCCCCCCCCCC(O)C(=O)[O-]}} |
| + | {{#set: molecular weight=299.473 }} | ||
| + | {{#set: inchi key=InChIKey=KIHBGTRZFAVZRV-QGZVFWFLSA-M}} | ||
| + | {{#set: common name=(R)-2-hydroxystearate}} | ||
| + | {{#set: consumed by=RXN66-474-R-2-HYDROXYSTEARATE/ATP/CO-A//CPD-14717/AMP/PPI.48.}} | ||
| + | {{#set: produced by=RXN-11820-STEARIC_ACID/HYDROGEN-PEROXIDE//R-2-HYDROXYSTEARATE/WATER.58.}} | ||
| + | {{#set: reversible reaction associated=ACECOATRANS-RXN-CPD-14717/ACET//R-2-HYDROXYSTEARATE/ACETYL-COA.47.}} | ||
Latest revision as of 16:59, 9 January 2019
Contents
Metabolite R-2-HYDROXYSTEARATE
- smiles:
- CCCCCCCCCCCCCCCCC(O)C(=O)[O-]
- molecular weight:
- 299.473
- inchi key:
- InChIKey=KIHBGTRZFAVZRV-QGZVFWFLSA-M
- common name:
- (R)-2-hydroxystearate
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCCCCCCCCCC(O)C(=O)[O-" cannot be used as a page name in this wiki.
