Difference between revisions of "CPD-448"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12128 CPD-12128] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CC...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-448 CPD-448] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(O)C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O) |
+ | * molecular weight: | ||
+ | ** 258.121 | ||
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=HXXFSFRBOHSIMQ-DVKNGEFBSA-L |
* common name: | * common name: | ||
− | ** | + | ** β-D-glucopyranose 1-phosphate |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** β-D-glucose 1-phosphate |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[BETA-PHOSPHOGLUCOMUTASE-RXN]] | ||
+ | * [[RXN-16995]] | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57684 57684] |
− | {{#set: smiles= | + | * PUBCHEM: |
− | {{#set: inchi key=InChIKey= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244208 25244208] |
− | {{#set: common name= | + | * LIGAND-CPD: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00663 C00663] | |
− | {{#set: common name= | + | {{#set: smiles=C(O)C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O)}} |
− | {{#set: | + | {{#set: molecular weight=258.121 }} |
+ | {{#set: inchi key=InChIKey=HXXFSFRBOHSIMQ-DVKNGEFBSA-L}} | ||
+ | {{#set: common name=β-D-glucopyranose 1-phosphate}} | ||
+ | {{#set: common name=β-D-glucose 1-phosphate}} | ||
+ | {{#set: reversible reaction associated=BETA-PHOSPHOGLUCOMUTASE-RXN|RXN-16995}} |
Latest revision as of 16:59, 9 January 2019
Contents
Metabolite CPD-448
- smiles:
- C(O)C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O)
- molecular weight:
- 258.121
- inchi key:
- InChIKey=HXXFSFRBOHSIMQ-DVKNGEFBSA-L
- common name:
- β-D-glucopyranose 1-phosphate
- Synonym(s):
- β-D-glucose 1-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O)" cannot be used as a page name in this wiki.