Difference between revisions of "D-AMINO-ACID-OXIDASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13172 CPD-13172] == * smiles: ** C(=O)(C1(O)(C=CCCC(=O)1))[O-] * inchi key: ** InChIKey=WEZ...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=D-AMINO-ACID-OXIDASE-RXN D-AMINO-ACID-OXIDASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/1.4.3.3 EC-1.4.3.3] | |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[WATER]][c] '''+''' 1 [[D-Amino-Acids]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[HYDROGEN-PEROXIDE]][c] '''+''' 1 [[2-Oxo-carboxylates]][c] '''+''' 1 [[AMMONIUM]][c] |
− | == | + | * With common name(s): |
+ | ** 1 H2O[c] '''+''' 1 a D-amino acid[c] '''+''' 1 oxygen[c] '''=>''' 1 hydrogen peroxide[c] '''+''' 1 a 2-oxo carboxylate[c] '''+''' 1 ammonium[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[CHC_T00003782001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | * Gene: [[CHC_T00003785001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=21816 21816] |
− | {{#set: | + | * UNIPROT: |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P00371 P00371] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q28382 Q28382] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P18894 P18894] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P22942 P22942] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q99042 Q99042] |
+ | * LIGAND-RXN: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?R01340 R01340] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: ec number=EC-1.4.3.3}} | ||
+ | {{#set: gene associated=CHC_T00003782001_1|CHC_T00003785001_1}} | ||
+ | {{#set: in pathway=}} | ||
+ | {{#set: reconstruction category=orthology}} | ||
+ | {{#set: reconstruction source=orthology-galdieria.sulphuraria}} | ||
+ | {{#set: reconstruction tool=pantograph}} |
Latest revision as of 17:01, 9 January 2019
Contents
Reaction D-AMINO-ACID-OXIDASE-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 D-Amino-Acids[c] + 1 OXYGEN-MOLECULE[c] => 1 HYDROGEN-PEROXIDE[c] + 1 2-Oxo-carboxylates[c] + 1 AMMONIUM[c]
- With common name(s):
- 1 H2O[c] + 1 a D-amino acid[c] + 1 oxygen[c] => 1 hydrogen peroxide[c] + 1 a 2-oxo carboxylate[c] + 1 ammonium[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00003782001_1
- Source: orthology-galdieria.sulphuraria
- Gene: CHC_T00003785001_1
- Source: orthology-galdieria.sulphuraria
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-galdieria.sulphuraria
- Tool: pantograph
- Source: orthology-galdieria.sulphuraria
External links