Difference between revisions of "CPD-564"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=NAPHTHOATE-SYN-RXN NAPHTHOATE-SYN-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** naphthoat...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-564 CPD-564] == |
− | * | + | * smiles: |
− | ** | + | ** C(CC([N+])C(=O)[O-])SCC1(OC(O)C(O)C(O)1) |
+ | * molecular weight: | ||
+ | ** 267.296 | ||
+ | * inchi key: | ||
+ | ** InChIKey=IQFWYNFDWRYSRA-OEQWSMLSSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** S-ribosyl-L-homocysteine |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** S-Ribosylhomocysteine | ||
+ | ** Ribose-5-S-homocysteine | ||
+ | ** S-D-ribosyl-L-homocysteine | ||
+ | ** ribose-5-S-homocysteine | ||
+ | ** S-ribosylhomocysteine | ||
+ | ** S-(5-deoxy-D-ribos-5-yl)-L-homocysteine | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[ADENOSYLHOMOCYSTEINE-NUCLEOSIDASE-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * CHEBI: |
− | ** [http://www.ebi.ac.uk/ | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17575 17575] |
− | * | + | * CAS : 37558-16-0 |
− | + | * BIGG : rhcys | |
− | * | + | * PUBCHEM: |
− | * | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245776 25245776] |
− | ** [http:// | + | * LIGAND-CPD: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03539 C03539] | |
− | + | {{#set: smiles=C(CC([N+])C(=O)[O-])SCC1(OC(O)C(O)C(O)1)}} | |
− | * | + | {{#set: molecular weight=267.296 }} |
− | ** [http://www. | + | {{#set: inchi key=InChIKey=IQFWYNFDWRYSRA-OEQWSMLSSA-N}} |
− | {{#set: | + | {{#set: common name=S-ribosyl-L-homocysteine}} |
− | + | {{#set: common name=S-Ribosylhomocysteine|Ribose-5-S-homocysteine|S-D-ribosyl-L-homocysteine|ribose-5-S-homocysteine|S-ribosylhomocysteine|S-(5-deoxy-D-ribos-5-yl)-L-homocysteine}} | |
− | + | {{#set: produced by=ADENOSYLHOMOCYSTEINE-NUCLEOSIDASE-RXN}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Latest revision as of 17:01, 9 January 2019
Contents
Metabolite CPD-564
- smiles:
- C(CC([N+])C(=O)[O-])SCC1(OC(O)C(O)C(O)1)
- molecular weight:
- 267.296
- inchi key:
- InChIKey=IQFWYNFDWRYSRA-OEQWSMLSSA-N
- common name:
- S-ribosyl-L-homocysteine
- Synonym(s):
- S-Ribosylhomocysteine
- Ribose-5-S-homocysteine
- S-D-ribosyl-L-homocysteine
- ribose-5-S-homocysteine
- S-ribosylhomocysteine
- S-(5-deoxy-D-ribos-5-yl)-L-homocysteine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(CC([N+])C(=O)[O-])SCC1(OC(O)C(O)C(O)1)" cannot be used as a page name in this wiki.