Difference between revisions of "CPD-12128"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9648 RXN-9648] == * direction: ** LEFT-TO-RIGHT * common name: ** Beta-ketoacyl synthase * ec n...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9648 RXN-9648] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12128 CPD-12128] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(C)=C(O)C2(C=CC=CC(C(O)=1)=2)))C)C)C
 +
* molecular weight:
 +
** 923.499   
 +
* inchi key:
 +
** InChIKey=ZXHQKRGMWKZWGN-RYZSZPJESA-N
 
* common name:
 
* common name:
−
** Beta-ketoacyl synthase
+
** menaquinol-11
−
* ec number:
+
−
** [http://enzyme.expasy.org/EC/2.3.1.86 EC-2.3.1.86]
+
−
** [http://enzyme.expasy.org/EC/2.3.1.85 EC-2.3.1.85]
+
−
** [http://enzyme.expasy.org/EC/2.3.1.41 EC-2.3.1.41]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** MKH2-11
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[PROTON]][c] '''+''' 1 [[MALONYL-COA]][c] '''+''' 1 [[Butanoyl-ACPs]][c] '''=>''' 1 [[CO-A]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[3-oxo-hexanoyl-ACPs]][c]
+
* [[RXN-9362]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H+[c] '''+''' 1 malonyl-CoA[c] '''+''' 1 a butyryl-[acp][c] '''=>''' 1 coenzyme A[c] '''+''' 1 CO2[c] '''+''' 1 a 3-oxo-hexanoyl-[acp][c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00009465001]]
+
−
** ORIGINAL_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
* [[PWY-5994]], palmitate biosynthesis I (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5994 PWY-5994]
+
−
** '''22''' reactions found over '''31''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[original_genome]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEBI:
−
{{#set: common name=Beta-ketoacyl synthase}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84547 84547]
−
{{#set: ec number=EC-2.3.1.86}}
+
* PUBCHEM:
−
{{#set: ec number=EC-2.3.1.85}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479543 45479543]
−
{{#set: ec number=EC-2.3.1.41}}
+
{{#set: smiles=CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(C)=C(O)C2(C=CC=CC(C(O)=1)=2)))C)C)C}}
−
{{#set: gene associated=CHC_T00009465001}}
+
{{#set: molecular weight=923.499    }}
−
{{#set: in pathway=PWY-5994}}
+
{{#set: inchi key=InChIKey=ZXHQKRGMWKZWGN-RYZSZPJESA-N}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: common name=menaquinol-11}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=MKH2-11}}
−
{{#set: reconstruction source=original_genome}}
+
{{#set: produced by=RXN-9362}}

Latest revision as of 17:02, 9 January 2019

Metabolite CPD-12128

  • smiles:
    • CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(C)=C(O)C2(C=CC=CC(C(O)=1)=2)))C)C)C
  • molecular weight:
    • 923.499
  • inchi key:
    • InChIKey=ZXHQKRGMWKZWGN-RYZSZPJESA-N
  • common name:
    • menaquinol-11
  • Synonym(s):
    • MKH2-11

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CPD-12128&oldid=22605"