Difference between revisions of "RXN0-747"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17312 CPD-17312] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17312 CPD-17312] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-747 RXN0-747] ==
* smiles:
+
* direction:
** CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=MENFZXMQSYYVRK-CRCGJGBYSA-J
+
 
* common name:
 
* common name:
** docosahexaenoyl-CoA
+
** ribonucleoside-diphosphate reductase alpha chain
* molecular weight:
+
** ribonucleoside-diphosphate reductase beta chain
** 1073.981   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.17.4.1 EC-1.17.4.1]
 
* Synonym(s):
 
* Synonym(s):
** all-cis-docosa-4,7,10,13,16,19-hexaenoyl-CoA
 
** (4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoyl-CoA
 
** (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-16137]]
+
** 1 [[ADP]][c] '''+''' 1 [[Reduced-NrdH-Proteins]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[Oxidized-NrdH-Proteins]][c] '''+''' 1 [[DADP]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 ADP[c] '''+''' 1 a reduced NrdH glutaredoxin-like protein[c] '''=>''' 1 H2O[c] '''+''' 1 an oxidized NrdH glutaredoxin-like protein[c] '''+''' 1 dADP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00008926001]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
* Gene: [[CHC_T00008864001]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
* Gene: [[CHC_T00008926001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
* Gene: [[CHC_T00008864001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
== Pathways  ==
 +
* [[PWY-7220]], adenosine deoxyribonucleotides de novo biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7220 PWY-7220]
 +
** '''3''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-original_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581248 71581248]
+
{{#set: common name=ribonucleoside-diphosphate reductase alpha chain}}
* CHEBI:
+
{{#set: common name=ribonucleoside-diphosphate reductase beta chain}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74298 74298]
+
{{#set: ec number=EC-1.17.4.1}}
{{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: gene associated=CHC_T00008926001|CHC_T00008864001|CHC_T00008926001_1|CHC_T00008864001_1}}
{{#set: inchi key=InChIKey=MENFZXMQSYYVRK-CRCGJGBYSA-J}}
+
{{#set: in pathway=PWY-7220}}
{{#set: common name=docosahexaenoyl-CoA}}
+
{{#set: reconstruction category=orthology|annotation}}
{{#set: molecular weight=1073.981    }}
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria|annotation-original_genome|orthology-ectocarpus_siliculosus}}
{{#set: common name=all-cis-docosa-4,7,10,13,16,19-hexaenoyl-CoA|(4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoyl-CoA|(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl-CoA}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
{{#set: produced by=RXN-16137}}
+

Latest revision as of 17:02, 9 January 2019

Reaction RXN0-747

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ribonucleoside-diphosphate reductase alpha chain
    • ribonucleoside-diphosphate reductase beta chain
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7220, adenosine deoxyribonucleotides de novo biosynthesis II: PWY-7220
    • 3 reactions found over 4 reactions in the full pathway

Reconstruction information

External links