Difference between revisions of "CPD-8620"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00003825001_1 == * Synonym(s): == Reactions associated == * CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN ** pantograph-a.taliana == Pathway...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8620 CPD-8620] == |
+ | * smiles: | ||
+ | ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC3)))CC4)))C | ||
+ | * molecular weight: | ||
+ | ** 384.644 | ||
+ | * inchi key: | ||
+ | ** InChIKey=RZSXSHNNQBIPTL-ZSBATXSLSA-N | ||
+ | * common name: | ||
+ | ** 5α-cholesta-8-en-3-one | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN66-23]] | |
− | == | + | == Reaction(s) of unknown directionality == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87056 87056] |
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44263324 44263324] | ||
+ | * HMDB : HMDB12178 | ||
+ | {{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC3)))CC4)))C}} | ||
+ | {{#set: molecular weight=384.644 }} | ||
+ | {{#set: inchi key=InChIKey=RZSXSHNNQBIPTL-ZSBATXSLSA-N}} | ||
+ | {{#set: common name=5α-cholesta-8-en-3-one}} | ||
+ | {{#set: produced by=RXN66-23}} |
Latest revision as of 17:03, 9 January 2019
Contents
Metabolite CPD-8620
- smiles:
- CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC3)))CC4)))C
- molecular weight:
- 384.644
- inchi key:
- InChIKey=RZSXSHNNQBIPTL-ZSBATXSLSA-N
- common name:
- 5α-cholesta-8-en-3-one
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC3)))CC4)))C" cannot be used as a page name in this wiki.