Difference between revisions of "DGTP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGTP DGTP] == * smiles: ** C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C=NC2(C(=...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))) | ** C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))) | ||
| + | * molecular weight: | ||
| + | ** 503.152 | ||
* inchi key: | * inchi key: | ||
** InChIKey=HAAZLUGHYHWQIW-KVQBGUIXSA-J | ** InChIKey=HAAZLUGHYHWQIW-KVQBGUIXSA-J | ||
* common name: | * common name: | ||
** dGTP | ** dGTP | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
** 2'-deoxyguanosine-5'-triphosphate | ** 2'-deoxyguanosine-5'-triphosphate | ||
| Line 16: | Line 16: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
* [[RXN-14217]] | * [[RXN-14217]] | ||
| − | |||
* [[RXN0-385]] | * [[RXN0-385]] | ||
| + | * [[RXN-14208]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
* [[DGDPKIN-RXN]] | * [[DGDPKIN-RXN]] | ||
| Line 23: | Line 23: | ||
* [[RXN-14207]] | * [[RXN-14207]] | ||
== External links == | == External links == | ||
| + | * BIGG : dgtp | ||
* CAS : 2564-35-4 | * CAS : 2564-35-4 | ||
| − | |||
| − | |||
* HMDB : HMDB01440 | * HMDB : HMDB01440 | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61429 61429] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61429 61429] | ||
| − | * | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00286 C00286] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246112 25246112] | ||
{{#set: smiles=C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))}} | {{#set: smiles=C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))}} | ||
| + | {{#set: molecular weight=503.152 }} | ||
{{#set: inchi key=InChIKey=HAAZLUGHYHWQIW-KVQBGUIXSA-J}} | {{#set: inchi key=InChIKey=HAAZLUGHYHWQIW-KVQBGUIXSA-J}} | ||
{{#set: common name=dGTP}} | {{#set: common name=dGTP}} | ||
| − | |||
{{#set: common name=2'-deoxyguanosine-5'-triphosphate|deoxy-GTP|deoxyguanosine-triphosphate}} | {{#set: common name=2'-deoxyguanosine-5'-triphosphate|deoxy-GTP|deoxyguanosine-triphosphate}} | ||
| − | {{#set: consumed by=RXN-14217 | + | {{#set: consumed by=RXN-14217|RXN0-385|RXN-14208}} |
{{#set: produced by=DGDPKIN-RXN}} | {{#set: produced by=DGDPKIN-RXN}} | ||
{{#set: reversible reaction associated=RXN-14207}} | {{#set: reversible reaction associated=RXN-14207}} | ||
Latest revision as of 17:12, 9 January 2019
Contents
Metabolite DGTP
- smiles:
- C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))
- molecular weight:
- 503.152
- inchi key:
- InChIKey=HAAZLUGHYHWQIW-KVQBGUIXSA-J
- common name:
- dGTP
- Synonym(s):
- 2'-deoxyguanosine-5'-triphosphate
- deoxy-GTP
- deoxyguanosine-triphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))" cannot be used as a page name in this wiki.
