Difference between revisions of "PELARGONIDIN-3-GLUCOSIDE-CMPD"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00005811001_1 == * Synonym(s): == Reactions associated == * 3.4.25.1-RXN ** pantograph-galdieria.sulphuraria == Pathways associated...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PELARGONIDIN-3-GLUCOSIDE-CMPD PELARGONIDIN-3-GLUCOSIDE-CMPD] == |
+ | * smiles: | ||
+ | ** C(O)C1(C(O)C(O)C(O)C(O1)OC3(=CC4(=C([O+]=C(C2(=CC=C(O)C=C2))3)C=C(C=C([O-])4)[O-]))) | ||
+ | * molecular weight: | ||
+ | ** 431.375 | ||
+ | * inchi key: | ||
+ | ** InChIKey=ABVCUBUIXWJYSE-GQUPQBGVSA-M | ||
+ | * common name: | ||
+ | ** pelargonidin-3-O-β-D-glucoside | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** callistephin | ||
+ | ** 3-(β-D-glucopyranosyloxy)-55,7-dihydroxy-2-(4-hydroxyphenyl)-1-benzopyrylium chloride | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-7828]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=31967 31967] | ||
+ | * METABOLIGHTS : MTBLC31967 | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102515300 102515300] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C12137 C12137] | ||
+ | {{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O1)OC3(=CC4(=C([O+]=C(C2(=CC=C(O)C=C2))3)C=C(C=C([O-])4)[O-])))}} | ||
+ | {{#set: molecular weight=431.375 }} | ||
+ | {{#set: inchi key=InChIKey=ABVCUBUIXWJYSE-GQUPQBGVSA-M}} | ||
+ | {{#set: common name=pelargonidin-3-O-β-D-glucoside}} | ||
+ | {{#set: common name=callistephin|3-(β-D-glucopyranosyloxy)-55,7-dihydroxy-2-(4-hydroxyphenyl)-1-benzopyrylium chloride}} | ||
+ | {{#set: consumed by=RXN-7828}} |
Latest revision as of 18:13, 9 January 2019
Contents
Metabolite PELARGONIDIN-3-GLUCOSIDE-CMPD
- smiles:
- C(O)C1(C(O)C(O)C(O)C(O1)OC3(=CC4(=C([O+]=C(C2(=CC=C(O)C=C2))3)C=C(C=C([O-])4)[O-])))
- molecular weight:
- 431.375
- inchi key:
- InChIKey=ABVCUBUIXWJYSE-GQUPQBGVSA-M
- common name:
- pelargonidin-3-O-β-D-glucoside
- Synonym(s):
- callistephin
- 3-(β-D-glucopyranosyloxy)-55,7-dihydroxy-2-(4-hydroxyphenyl)-1-benzopyrylium chloride
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C1(C(O)C(O)C(O)C(O1)OC3(=CC4(=C([O+]=C(C2(=CC=C(O)C=C2))3)C=C(C=C([O-])4)[O-])))" cannot be used as a page name in this wiki.