Difference between revisions of "RXN-12460"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-318 CPD-318] == * smiles: ** C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1) * inchi key: ** InChIKey=LHFJO...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-318 CPD-318] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12460 RXN-12460] ==
−
* smiles:
+
* direction:
−
** C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=LHFJOBMTAJJOTB-JLAZNSOCSA-N
+
 
* common name:
 
* common name:
−
** monodehydroascorbate radical
+
** L-asparaginyl-tRNAasn hydrolase
−
* molecular weight:
+
** Peptidyl-tRNA hydrolase 2, mitochondrial
−
** 175.118   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/3.1.1.29 EC-3.1.1.29]
 
* Synonym(s):
 
* Synonym(s):
−
** monodehydroascorbic acid
 
−
** semidehydroascorbic acid
 
−
** semidehydroascorbate
 
−
** ascorbyl radical
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-3523]]
+
* With identifiers:
−
* [[1.6.5.4-RXN]]
+
** 1 [[WATER]][c] '''+''' 1 [[Charged-ASN-tRNAs]][c] '''=>''' 1 [[ASN]][c] '''+''' 1 [[ASN-tRNAs]][c] '''+''' 1 [[PROTON]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
* [[RXN-3541]]
+
** 1 H2O[c] '''+''' 1 an L-asparaginyl-[tRNAasn][c] '''=>''' 1 L-asparagine[c] '''+''' 1 tRNAasn[c] '''+''' 1 H+[c]
−
* [[RXN-10981]]
+
 
−
* [[RXN-3521]]
+
== Genes associated with this reaction  ==
−
== Reaction(s) of unknown directionality ==
+
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00006238001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
* Gene: [[CHC_T00008495001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
* Gene: [[CHC_T00008495001]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY490-4]], L-asparagine biosynthesis III (tRNA-dependent): [http://metacyc.org/META/NEW-IMAGE?object=PWY490-4 PWY490-4]
 +
** '''2''' reactions found over '''3''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-original_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5483640 5483640]
+
{{#set: common name=L-asparaginyl-tRNAasn hydrolase}}
−
* CHEBI:
+
{{#set: common name=Peptidyl-tRNA hydrolase 2, mitochondrial}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16504 16504]
+
{{#set: ec number=EC-3.1.1.29}}
−
* LIGAND-CPD:
+
{{#set: gene associated=CHC_T00006238001_1|CHC_T00008495001_1|CHC_T00008495001}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01041 C01041]
+
{{#set: in pathway=PWY490-4}}
−
{{#set: smiles=C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1)}}
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: inchi key=InChIKey=LHFJOBMTAJJOTB-JLAZNSOCSA-N}}
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria|annotation-original_genome|orthology-ectocarpus_siliculosus}}
−
{{#set: common name=monodehydroascorbate radical}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: molecular weight=175.118    }}
+
−
{{#set: common name=monodehydroascorbic acid|semidehydroascorbic acid|semidehydroascorbate|ascorbyl radical}}
+
−
{{#set: consumed by=RXN-3523|1.6.5.4-RXN}}
+
−
{{#set: produced by=RXN-3541|RXN-10981|RXN-3521}}
+

Latest revision as of 18:13, 9 January 2019

Reaction RXN-12460

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • L-asparaginyl-tRNAasn hydrolase
    • Peptidyl-tRNA hydrolase 2, mitochondrial
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H2O[c] + 1 an L-asparaginyl-[tRNAasn][c] => 1 L-asparagine[c] + 1 tRNAasn[c] + 1 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY490-4, L-asparagine biosynthesis III (tRNA-dependent): PWY490-4
    • 2 reactions found over 3 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-12460&oldid=22844"