Difference between revisions of "CPD-15666"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11020 CPD-11020] == * smiles: ** C(=O)([O-])C(=O)CC(O)CCl * inchi key: ** InChIKey=FHWPHVIG...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11020 CPD-11020] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15666 CPD-15666] ==
 
* smiles:
 
* smiles:
** C(=O)([O-])C(=O)CC(O)CCl
+
** CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 +
* molecular weight:
 +
** 955.803   
 
* inchi key:
 
* inchi key:
** InChIKey=FHWPHVIGZZAXIQ-VKHMYHEASA-M
+
** InChIKey=OOSDLBAXVXKFIB-GTUBXKNVSA-J
 
* common name:
 
* common name:
** 5-chloro-4-hydroxy-2-oxopentanoate
+
** 6-cis, 2-trans-tridecadienoyl-CoA
* molecular weight:
+
** 165.553   
+
 
* Synonym(s):
 
* Synonym(s):
** 5-chloro-4-hydroxy-2-oxovalerate
+
** 6Z, 2E-tridecadienoyl-CoA
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11717]]
+
* [[RXN-14771]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
 
* PUBCHEM:
 
* PUBCHEM:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49859580 49859580]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658546 90658546]
{{#set: smiles=C(=O)([O-])C(=O)CC(O)CCl}}
+
{{#set: smiles=CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
{{#set: inchi key=InChIKey=FHWPHVIGZZAXIQ-VKHMYHEASA-M}}
+
{{#set: molecular weight=955.803    }}
{{#set: common name=5-chloro-4-hydroxy-2-oxopentanoate}}
+
{{#set: inchi key=InChIKey=OOSDLBAXVXKFIB-GTUBXKNVSA-J}}
{{#set: molecular weight=165.553    }}
+
{{#set: common name=6-cis, 2-trans-tridecadienoyl-CoA}}
{{#set: common name=5-chloro-4-hydroxy-2-oxovalerate}}
+
{{#set: common name=6Z, 2E-tridecadienoyl-CoA}}
{{#set: produced by=RXN-11717}}
+
{{#set: produced by=RXN-14771}}

Latest revision as of 18:17, 9 January 2019

Metabolite CPD-15666

  • smiles:
    • CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • molecular weight:
    • 955.803
  • inchi key:
    • InChIKey=OOSDLBAXVXKFIB-GTUBXKNVSA-J
  • common name:
    • 6-cis, 2-trans-tridecadienoyl-CoA
  • Synonym(s):
    • 6Z, 2E-tridecadienoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.