Difference between revisions of "EDTA"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EDTA EDTA] == * smiles: ** C(C[N+](CC([O-])=O)CC([O-])=O)[N+](CC([O-])=O)CC([O-])=O * inchi key...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(C[N+](CC([O-])=O)CC([O-])=O)[N+](CC([O-])=O)CC([O-])=O | ** C(C[N+](CC([O-])=O)CC([O-])=O)[N+](CC([O-])=O)CC([O-])=O | ||
+ | * molecular weight: | ||
+ | ** 290.229 | ||
* inchi key: | * inchi key: | ||
** InChIKey=KCXVZYZYPLLWCC-UHFFFAOYSA-L | ** InChIKey=KCXVZYZYPLLWCC-UHFFFAOYSA-L | ||
* common name: | * common name: | ||
** EDTA | ** EDTA | ||
− | |||
− | |||
* Synonym(s): | * Synonym(s): | ||
** ethylenediaminetetraacetic acid | ** ethylenediaminetetraacetic acid | ||
Line 20: | Line 20: | ||
* [[ExchangeSeed_EDTA]] | * [[ExchangeSeed_EDTA]] | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=42191 42191] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=42191 42191] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201827 25201827] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C00284 C00284] | ** [http://www.genome.jp/dbget-bin/www_bget?C00284 C00284] | ||
* HMDB : HMDB15109 | * HMDB : HMDB15109 | ||
{{#set: smiles=C(C[N+](CC([O-])=O)CC([O-])=O)[N+](CC([O-])=O)CC([O-])=O}} | {{#set: smiles=C(C[N+](CC([O-])=O)CC([O-])=O)[N+](CC([O-])=O)CC([O-])=O}} | ||
+ | {{#set: molecular weight=290.229 }} | ||
{{#set: inchi key=InChIKey=KCXVZYZYPLLWCC-UHFFFAOYSA-L}} | {{#set: inchi key=InChIKey=KCXVZYZYPLLWCC-UHFFFAOYSA-L}} | ||
{{#set: common name=EDTA}} | {{#set: common name=EDTA}} | ||
− | |||
{{#set: common name=ethylenediaminetetraacetic acid|ethylenediaminetetraacetate}} | {{#set: common name=ethylenediaminetetraacetic acid|ethylenediaminetetraacetate}} | ||
{{#set: consumed by=TransportSeed_EDTA}} | {{#set: consumed by=TransportSeed_EDTA}} | ||
{{#set: produced by=TransportSeed_EDTA}} | {{#set: produced by=TransportSeed_EDTA}} | ||
{{#set: reversible reaction associated=ExchangeSeed_EDTA}} | {{#set: reversible reaction associated=ExchangeSeed_EDTA}} |
Latest revision as of 18:20, 9 January 2019
Contents
Metabolite EDTA
- smiles:
- C(C[N+](CC([O-])=O)CC([O-])=O)[N+](CC([O-])=O)CC([O-])=O
- molecular weight:
- 290.229
- inchi key:
- InChIKey=KCXVZYZYPLLWCC-UHFFFAOYSA-L
- common name:
- EDTA
- Synonym(s):
- ethylenediaminetetraacetic acid
- ethylenediaminetetraacetate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C[N+](CC([O-])=O)CC([O-])=O)[N+](CC([O-])=O)CC([O-])=O" cannot be used as a page name in this wiki.