Difference between revisions of "44-DIMETHYL-824-CHOLESTADIENOL"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET] == * smiles:...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=44-DIMETHYL-824-CHOLESTADIENOL 44-DIMETHYL-824-CHOLESTADIENOL] == |
* smiles: | * smiles: | ||
− | ** CC( | + | ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)(C)C(O)CCC(C)1C=2CCC(C)34)))) |
+ | * molecular weight: | ||
+ | ** 412.698 | ||
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=CHGIKSSZNBCNDW-QGBOJXOESA-N |
* common name: | * common name: | ||
− | ** | + | ** 4,4-dimethylzymosterol |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 4,4-dimethyl-8,24-cholestadienol |
− | ** | + | ** 4,4-dimethyl-5α-cholesta-8,24-dien-3β-ol |
− | ** | + | ** 14-demethyllanosterol |
− | ** 4- | + | ** 17-(1,5-dimethylhex-4-enyl)-4,4,10,13-tetramethyl-2,3,4,5,6,7, 10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a] phenanthren-3-ol |
+ | ** 4,4-dimethyl-5α-cholesta-8,24-dien-3-β-ol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-13712]] |
+ | * [[RXN66-310]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN66-306]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18364 18364] |
− | * | + | * METABOLIGHTS : MTBLC18364 |
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=165609 165609] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05108 C05108] |
− | {{#set: smiles=CC( | + | * HMDB : HMDB01286 |
− | {{#set: inchi key=InChIKey= | + | {{#set: smiles=CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)(C)C(O)CCC(C)1C=2CCC(C)34))))}} |
− | {{#set: common name= | + | {{#set: molecular weight=412.698 }} |
− | + | {{#set: inchi key=InChIKey=CHGIKSSZNBCNDW-QGBOJXOESA-N}} | |
− | {{#set: common name= | + | {{#set: common name=4,4-dimethylzymosterol}} |
− | {{#set: consumed by= | + | {{#set: common name=4,4-dimethyl-8,24-cholestadienol|4,4-dimethyl-5α-cholesta-8,24-dien-3β-ol|14-demethyllanosterol|17-(1,5-dimethylhex-4-enyl)-4,4,10,13-tetramethyl-2,3,4,5,6,7, 10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a] phenanthren-3-ol|4,4-dimethyl-5α-cholesta-8,24-dien-3-β-ol}} |
− | {{#set: produced by= | + | {{#set: consumed by=RXN-13712|RXN66-310}} |
+ | {{#set: produced by=RXN66-306}} |
Latest revision as of 18:20, 9 January 2019
Contents
Metabolite 44-DIMETHYL-824-CHOLESTADIENOL
- smiles:
- CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)(C)C(O)CCC(C)1C=2CCC(C)34))))
- molecular weight:
- 412.698
- inchi key:
- InChIKey=CHGIKSSZNBCNDW-QGBOJXOESA-N
- common name:
- 4,4-dimethylzymosterol
- Synonym(s):
- 4,4-dimethyl-8,24-cholestadienol
- 4,4-dimethyl-5α-cholesta-8,24-dien-3β-ol
- 14-demethyllanosterol
- 17-(1,5-dimethylhex-4-enyl)-4,4,10,13-tetramethyl-2,3,4,5,6,7, 10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a] phenanthren-3-ol
- 4,4-dimethyl-5α-cholesta-8,24-dien-3-β-ol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)(C)C(O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.
"17-(1,5-dimethylhex-4-enyl)-4,4,10,13-tetramethyl-2,3,4,5,6,7, 10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a] phenanthren-3-ol" cannot be used as a page name in this wiki.