Difference between revisions of "CPD-7030"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed_PPI TransportSeed_PPI] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Fo...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed_PPI TransportSeed_PPI] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7030 CPD-7030] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CC(C)C(CC([O-])=O)=O
 +
* molecular weight:
 +
** 129.135   
 +
* inchi key:
 +
** InChIKey=ZXLSKTZECNUVIS-UHFFFAOYSA-M
 +
* common name:
 +
** β-ketoisocaproate
 
* Synonym(s):
 
* Synonym(s):
 +
** 4-methyl-3-oxopentanoate
 +
** 3-oxo-4-methylpentanoate
 +
** β-oxo-4-methylcaproate
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-7691]]
** 1.0 [[PPI]][e] '''=>''' 1.0 [[PPI]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
* [[RXN-7690]]
** 1.0 diphosphate[e] '''=>''' 1.0 diphosphate[c]
+
== Reaction(s) of unknown directionality ==
 
+
== Genes associated with this reaction  ==
+
== Pathways  ==
+
== Reconstruction information  ==
+
* [[manual]]:
+
** [[added to manage seeds from extracellular to cytosol compartment]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEBI:
{{#set: in pathway=}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62222 62222]
{{#set: reconstruction category=manual}}
+
* PUBCHEM:
{{#set: reconstruction source=added to manage seeds from extracellular to cytosol compartment}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22019185 22019185]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C03467 C03467]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.10755343.html 10755343]
 +
{{#set: smiles=CC(C)C(CC([O-])=O)=O}}
 +
{{#set: molecular weight=129.135    }}
 +
{{#set: inchi key=InChIKey=ZXLSKTZECNUVIS-UHFFFAOYSA-M}}
 +
{{#set: common name=β-ketoisocaproate}}
 +
{{#set: common name=4-methyl-3-oxopentanoate|3-oxo-4-methylpentanoate|β-oxo-4-methylcaproate}}
 +
{{#set: consumed by=RXN-7691}}
 +
{{#set: produced by=RXN-7690}}

Latest revision as of 17:21, 9 January 2019

Metabolite CPD-7030

  • smiles:
    • CC(C)C(CC([O-])=O)=O
  • molecular weight:
    • 129.135
  • inchi key:
    • InChIKey=ZXLSKTZECNUVIS-UHFFFAOYSA-M
  • common name:
    • β-ketoisocaproate
  • Synonym(s):
    • 4-methyl-3-oxopentanoate
    • 3-oxo-4-methylpentanoate
    • β-oxo-4-methylcaproate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(CC([O-])=O)=O" cannot be used as a page name in this wiki.