Difference between revisions of "ILE"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00008322001_1 == * Synonym(s): == Reactions associated == * PEPTIDYLPROLYL-ISOMERASE-RXN ** pantograph-galdieria.sulphuraria == Pat...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ILE ILE] == |
+ | * smiles: | ||
+ | ** CCC(C)C([N+])C(=O)[O-] | ||
+ | * molecular weight: | ||
+ | ** 131.174 | ||
+ | * inchi key: | ||
+ | ** InChIKey=AGPKZVBTJJNPAG-WHFBIAKZSA-N | ||
+ | * common name: | ||
+ | ** L-isoleucine | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** I | ||
+ | ** ile | ||
+ | ** iso-leucine | ||
+ | ** L-ile | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[ISOLEUCINE--TRNA-LIGASE-RXN]] |
− | + | * [[biomass_rxn]] | |
− | == | + | == Reaction(s) known to produce the compound == |
+ | == Reaction(s) of unknown directionality == | ||
+ | * [[BRANCHED-CHAINAMINOTRANSFERILEU-RXN]] | ||
== External links == | == External links == | ||
− | {{#set: reaction associated= | + | * METABOLIGHTS : MTBLC58045 |
+ | * BIGG : ile__L | ||
+ | * CAS : 73-32-5 | ||
+ | * HMDB : HMDB00172 | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58045 58045] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00407 C00407] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7043901 7043901] | ||
+ | {{#set: smiles=CCC(C)C([N+])C(=O)[O-]}} | ||
+ | {{#set: molecular weight=131.174 }} | ||
+ | {{#set: inchi key=InChIKey=AGPKZVBTJJNPAG-WHFBIAKZSA-N}} | ||
+ | {{#set: common name=L-isoleucine}} | ||
+ | {{#set: common name=I|ile|iso-leucine|L-ile}} | ||
+ | {{#set: consumed by=ISOLEUCINE--TRNA-LIGASE-RXN|biomass_rxn}} | ||
+ | {{#set: reversible reaction associated=BRANCHED-CHAINAMINOTRANSFERILEU-RXN}} |
Latest revision as of 18:23, 9 January 2019
Contents
Metabolite ILE
- smiles:
- CCC(C)C([N+])C(=O)[O-]
- molecular weight:
- 131.174
- inchi key:
- InChIKey=AGPKZVBTJJNPAG-WHFBIAKZSA-N
- common name:
- L-isoleucine
- Synonym(s):
- I
- ile
- iso-leucine
- L-ile
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- METABOLIGHTS : MTBLC58045
- BIGG : ile__L
- CAS : 73-32-5
- HMDB : HMDB00172
- CHEBI:
- LIGAND-CPD:
- PUBCHEM:
"CCC(C)C([N+])C(=O)[O-" cannot be used as a page name in this wiki.