Difference between revisions of "CPD-318"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00009389001_1 == * Synonym(s): == Reactions associated == * 5.3.4.1-RXN ** pantograph-galdieria.sulphuraria * DISULISOM-RXN **...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-318 CPD-318] == |
| + | * smiles: | ||
| + | ** C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1) | ||
| + | * molecular weight: | ||
| + | ** 175.118 | ||
| + | * inchi key: | ||
| + | ** InChIKey=LHFJOBMTAJJOTB-JLAZNSOCSA-N | ||
| + | * common name: | ||
| + | ** monodehydroascorbate radical | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** monodehydroascorbic acid | ||
| + | ** semidehydroascorbic acid | ||
| + | ** semidehydroascorbate | ||
| + | ** ascorbyl radical | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[5 | + | * [[1.6.5.4-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * [[ | + | * [[RXN-3521]] |
| − | + | * [[RXN-3541]] | |
| − | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
| − | {{#set: | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16504 16504] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5483640 5483640] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01041 C01041] | ||
| + | {{#set: smiles=C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1)}} | ||
| + | {{#set: molecular weight=175.118 }} | ||
| + | {{#set: inchi key=InChIKey=LHFJOBMTAJJOTB-JLAZNSOCSA-N}} | ||
| + | {{#set: common name=monodehydroascorbate radical}} | ||
| + | {{#set: common name=monodehydroascorbic acid|semidehydroascorbic acid|semidehydroascorbate|ascorbyl radical}} | ||
| + | {{#set: consumed by=1.6.5.4-RXN}} | ||
| + | {{#set: produced by=RXN-3521|RXN-3541}} | ||
Latest revision as of 17:25, 9 January 2019
Contents
Metabolite CPD-318
- smiles:
- C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1)
- molecular weight:
- 175.118
- inchi key:
- InChIKey=LHFJOBMTAJJOTB-JLAZNSOCSA-N
- common name:
- monodehydroascorbate radical
- Synonym(s):
- monodehydroascorbic acid
- semidehydroascorbic acid
- semidehydroascorbate
- ascorbyl radical
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1)" cannot be used as a page name in this wiki.
