Difference between revisions of "CPD-11020"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00002327001_1 == * Synonym(s): == Reactions associated == * RXN0-7023 ** pantograph-galdieria.sulphuraria == Pathways associated ==...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene CHC_T00002327001_1 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11020 CPD-11020] ==
 +
* smiles:
 +
** C(=O)([O-])C(=O)CC(O)CCl
 +
* molecular weight:
 +
** 165.553   
 +
* inchi key:
 +
** InChIKey=FHWPHVIGZZAXIQ-VKHMYHEASA-M
 +
* common name:
 +
** 5-chloro-4-hydroxy-2-oxopentanoate
 
* Synonym(s):
 
* Synonym(s):
 +
** 5-chloro-4-hydroxy-2-oxovalerate
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[RXN0-7023]]
+
== Reaction(s) known to produce the compound ==
** [[pantograph]]-[[galdieria.sulphuraria]]
+
* [[RXN-11717]]
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=RXN0-7023}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49859580 49859580]
 +
{{#set: smiles=C(=O)([O-])C(=O)CC(O)CCl}}
 +
{{#set: molecular weight=165.553    }}
 +
{{#set: inchi key=InChIKey=FHWPHVIGZZAXIQ-VKHMYHEASA-M}}
 +
{{#set: common name=5-chloro-4-hydroxy-2-oxopentanoate}}
 +
{{#set: common name=5-chloro-4-hydroxy-2-oxovalerate}}
 +
{{#set: produced by=RXN-11717}}

Latest revision as of 17:26, 9 January 2019

Metabolite CPD-11020

  • smiles:
    • C(=O)([O-])C(=O)CC(O)CCl
  • molecular weight:
    • 165.553
  • inchi key:
    • InChIKey=FHWPHVIGZZAXIQ-VKHMYHEASA-M
  • common name:
    • 5-chloro-4-hydroxy-2-oxopentanoate
  • Synonym(s):
    • 5-chloro-4-hydroxy-2-oxovalerate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=O)([O-])C(=O)CC(O)CCl" cannot be used as a page name in this wiki.