Difference between revisions of "INDOLE-3-GLYCOL"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00010324001_1 == * Synonym(s): == Reactions associated == * RXN-8443 ** pantograph-a.taliana == Pathways associated == * PWY-5381...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene CHC_T00010324001_1 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE-3-GLYCOL INDOLE-3-GLYCOL] ==
 +
* smiles:
 +
** C2(=C(C1(C=CC=CC=1N2))C(O)CO)
 +
* molecular weight:
 +
** 177.202   
 +
* inchi key:
 +
** InChIKey=XNJDZRGYWQBBMZ-UHFFFAOYSA-N
 +
* common name:
 +
** indole-3-glycol
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[RXN-8443]]
+
== Reaction(s) known to produce the compound ==
** [[pantograph]]-[[a.taliana]]
+
* [[RXN-5424]]
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
* [[PWY-5381]]
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=RXN-8443}}
+
* PUBCHEM:
{{#set: pathway associated=PWY-5381}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202910 25202910]
 +
{{#set: smiles=C2(=C(C1(C=CC=CC=1N2))C(O)CO)}}
 +
{{#set: molecular weight=177.202    }}
 +
{{#set: inchi key=InChIKey=XNJDZRGYWQBBMZ-UHFFFAOYSA-N}}
 +
{{#set: common name=indole-3-glycol}}
 +
{{#set: produced by=RXN-5424}}

Latest revision as of 17:28, 9 January 2019

Metabolite INDOLE-3-GLYCOL

  • smiles:
    • C2(=C(C1(C=CC=CC=1N2))C(O)CO)
  • molecular weight:
    • 177.202
  • inchi key:
    • InChIKey=XNJDZRGYWQBBMZ-UHFFFAOYSA-N
  • common name:
    • indole-3-glycol
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links