Difference between revisions of "GDP-TP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7663 RXN-7663] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/2....")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7663 RXN-7663] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-TP GDP-TP] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C(OP([O-])(=O)OP([O-])(=O)OP([O-])(=O)[O-])C1(OC(C(O)C(OP([O-])(=O)OP(O)([O-])=O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))
* ec number:
+
* molecular weight:
** [http://enzyme.expasy.org/EC/2.5.1.62 EC-2.5.1.62]
+
** 677.095   
 +
* inchi key:
 +
** InChIKey=KCPMACXZAITQAX-UUOKFMHZSA-H
 +
* common name:
 +
** pppGpp
 
* Synonym(s):
 
* Synonym(s):
 +
** guanosine pentaphosphate
 +
** guanosine 3'-diphosphate 5'-triphosphate
 +
** guanosine 5'-triphosphate,3'-diphosphate
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN0-6427]]
** 1 [[CHLOROPHYLLIDE-A]][c] '''+''' 1 [[GERANYLGERANYL-PP]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[CPD-7005]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 chlorophyllide a[c] '''+''' 1 geranylgeranyl diphosphate[c] '''+''' 1 H+[c] '''=>''' 1 diphosphate[c] '''+''' 1 geranylgeranyl chlorophyll a[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[CHC_T00008377001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
== Pathways  ==
+
* [[PWY-5064]], chlorophyll a biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5064 PWY-5064]
+
** '''5''' reactions found over '''5''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[galdieria.sulphuraria]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEBI:
{{#set: ec number=EC-2.5.1.62}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16690 16690]
{{#set: gene associated=CHC_T00008377001_1}}
+
* BIGG : gdptp
{{#set: in pathway=PWY-5064}}
+
* PUBCHEM:
{{#set: reconstruction category=orthology}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173549 46173549]
{{#set: reconstruction tool=pantograph}}
+
* LIGAND-CPD:
{{#set: reconstruction source=galdieria.sulphuraria}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C04494 C04494]
 +
* HMDB : HMDB60480
 +
{{#set: smiles=C(OP([O-])(=O)OP([O-])(=O)OP([O-])(=O)[O-])C1(OC(C(O)C(OP([O-])(=O)OP(O)([O-])=O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))}}
 +
{{#set: molecular weight=677.095    }}
 +
{{#set: inchi key=InChIKey=KCPMACXZAITQAX-UUOKFMHZSA-H}}
 +
{{#set: common name=pppGpp}}
 +
{{#set: common name=guanosine pentaphosphate|guanosine 3'-diphosphate 5'-triphosphate|guanosine 5'-triphosphate,3'-diphosphate}}
 +
{{#set: consumed by=RXN0-6427}}

Latest revision as of 18:30, 9 January 2019

Metabolite GDP-TP

  • smiles:
    • C(OP([O-])(=O)OP([O-])(=O)OP([O-])(=O)[O-])C1(OC(C(O)C(OP([O-])(=O)OP(O)([O-])=O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))
  • molecular weight:
    • 677.095
  • inchi key:
    • InChIKey=KCPMACXZAITQAX-UUOKFMHZSA-H
  • common name:
    • pppGpp
  • Synonym(s):
    • guanosine pentaphosphate
    • guanosine 3'-diphosphate 5'-triphosphate
    • guanosine 5'-triphosphate,3'-diphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP([O-])(=O)OP([O-])(=O)OP([O-])(=O)[O-])C1(OC(C(O)C(OP([O-])(=O)OP(O)([O-])=O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))" cannot be used as a page name in this wiki.