Difference between revisions of "CPD-15435"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-224 CPD-224] == * common name: ** a dolichyl diphosphate * Synonym(s): == Reaction(s) know...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-224 CPD-224] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15435 CPD-15435] ==
 +
* smiles:
 +
** CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))([O-])=O
 +
* molecular weight:
 +
** 490.322   
 +
* inchi key:
 +
** InChIKey=GHLUPQUHEIJRCU-DWVDDHQFSA-L
 
* common name:
 
* common name:
** a dolichyl diphosphate
+
** L-threonylcarbamoyladenylate
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-14570]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.4.1.119-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-16761]]
 
 
== External links  ==
 
== External links  ==
{{#set: common name=a dolichyl diphosphate}}
+
* CHEBI:
{{#set: produced by=2.4.1.119-RXN}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73682 73682]
{{#set: consumed or produced by=RXN-16761}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71464565 71464565]
 +
{{#set: smiles=CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))([O-])=O}}
 +
{{#set: molecular weight=490.322    }}
 +
{{#set: inchi key=InChIKey=GHLUPQUHEIJRCU-DWVDDHQFSA-L}}
 +
{{#set: common name=L-threonylcarbamoyladenylate}}
 +
{{#set: consumed by=RXN-14570}}

Latest revision as of 17:30, 9 January 2019

Metabolite CPD-15435

  • smiles:
    • CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))([O-])=O
  • molecular weight:
    • 490.322
  • inchi key:
    • InChIKey=GHLUPQUHEIJRCU-DWVDDHQFSA-L
  • common name:
    • L-threonylcarbamoyladenylate
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))([O-])=O" cannot be used as a page name in this wiki.