Difference between revisions of "CPD-11671"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-LEU-tRNAs Charged-LEU-tRNAs] == * common name: ** an L-leucyl-[tRNAleu] * Synonym(s):...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11671 CPD-11671] == |
+ | * smiles: | ||
+ | ** C(O)CC1(=CNC2(=C1C=C(O)C=C2)) | ||
+ | * molecular weight: | ||
+ | ** 177.202 | ||
+ | * inchi key: | ||
+ | ** InChIKey=KQROHCSYOGBQGJ-UHFFFAOYSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** 5-hydroxytryptophol |
* Synonym(s): | * Synonym(s): | ||
+ | ** hydroxytryptophol | ||
+ | ** 5-hydroxyindole-3-ethanol | ||
+ | ** 5-hydroxy-1H-indole-3-ethanol | ||
+ | ** 1H-indole-3-ethanol, 5-hydroxy- | ||
+ | ** indole-3-ethanol, 5-hydroxy- | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-10781]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9061 9061] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.8708.html 8708] | ||
+ | * HMDB : HMDB01855 | ||
+ | {{#set: smiles=C(O)CC1(=CNC2(=C1C=C(O)C=C2))}} | ||
+ | {{#set: molecular weight=177.202 }} | ||
+ | {{#set: inchi key=InChIKey=KQROHCSYOGBQGJ-UHFFFAOYSA-N}} | ||
+ | {{#set: common name=5-hydroxytryptophol}} | ||
+ | {{#set: common name=hydroxytryptophol|5-hydroxyindole-3-ethanol|5-hydroxy-1H-indole-3-ethanol|1H-indole-3-ethanol, 5-hydroxy-|indole-3-ethanol, 5-hydroxy-}} | ||
+ | {{#set: produced by=RXN-10781}} |
Latest revision as of 17:30, 9 January 2019
Contents
Metabolite CPD-11671
- smiles:
- C(O)CC1(=CNC2(=C1C=C(O)C=C2))
- molecular weight:
- 177.202
- inchi key:
- InChIKey=KQROHCSYOGBQGJ-UHFFFAOYSA-N
- common name:
- 5-hydroxytryptophol
- Synonym(s):
- hydroxytryptophol
- 5-hydroxyindole-3-ethanol
- 5-hydroxy-1H-indole-3-ethanol
- 1H-indole-3-ethanol, 5-hydroxy-
- indole-3-ethanol, 5-hydroxy-
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links