Difference between revisions of "LIPOIC-ACID"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SIROHYDROCHLORIN SIROHYDROCHLORIN] == * smiles: ** CC2(CC(=O)[O-])(C1(=CC5(=NC(=CC4(NC(C=C3(N=C...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LIPOIC-ACID LIPOIC-ACID] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(CCC(=O)[O-])CC1(CCSS1) |
| + | * molecular weight: | ||
| + | ** 205.309 | ||
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=AGBQKNBQESQNJD-SSDOTTSWSA-M |
* common name: | * common name: | ||
| − | ** | + | ** (R)-lipoate |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** α-liponic acid |
| + | ** 5-(1,2-dithiolan-3-yl)-pentanoate | ||
| + | ** lipoic acid | ||
| + | ** 6,8-thioctic acid | ||
| + | ** 6,8-thioctate | ||
| + | ** DL-thioctic acid | ||
| + | ** DL-thioctate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-17127]] |
| + | * [[RXN0-1141]] | ||
| + | * [[RXN-8654]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | * CAS : | + | * METABOLIGHTS : MTBLC30313 |
| − | * | + | * CAS : 62-46-4 |
| − | ** [http:// | + | * HMDB : HMDB01451 |
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.841.html 841] | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83088 83088] |
| − | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16241 C16241] |
| − | {{#set: smiles= | + | * PUBCHEM: |
| − | {{#set: inchi key=InChIKey= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1549144 1549144] |
| − | {{#set: common name= | + | {{#set: smiles=C(CCC(=O)[O-])CC1(CCSS1)}} |
| − | + | {{#set: molecular weight=205.309 }} | |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=AGBQKNBQESQNJD-SSDOTTSWSA-M}} |
| − | {{#set: consumed by= | + | {{#set: common name=(R)-lipoate}} |
| + | {{#set: common name=α-liponic acid|5-(1,2-dithiolan-3-yl)-pentanoate|lipoic acid|6,8-thioctic acid|6,8-thioctate|DL-thioctic acid|DL-thioctate}} | ||
| + | {{#set: consumed by=RXN-17127|RXN0-1141|RXN-8654}} | ||
Latest revision as of 18:32, 9 January 2019
Contents
Metabolite LIPOIC-ACID
- smiles:
- C(CCC(=O)[O-])CC1(CCSS1)
- molecular weight:
- 205.309
- inchi key:
- InChIKey=AGBQKNBQESQNJD-SSDOTTSWSA-M
- common name:
- (R)-lipoate
- Synonym(s):
- α-liponic acid
- 5-(1,2-dithiolan-3-yl)-pentanoate
- lipoic acid
- 6,8-thioctic acid
- 6,8-thioctate
- DL-thioctic acid
- DL-thioctate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- METABOLIGHTS : MTBLC30313
- CAS : 62-46-4
- HMDB : HMDB01451
- CHEMSPIDER:
- CHEBI:
- LIGAND-CPD:
- PUBCHEM:
"C(CCC(=O)[O-])CC1(CCSS1)" cannot be used as a page name in this wiki.
