Difference between revisions of "CPD-18841"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17203 RXN-17203] == * direction: ** REVERSIBLE * common name: ** Glycolipid sulfotransferase *...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18841 CPD-18841] == |
− | * | + | * smiles: |
− | ** | + | ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-]C5=C(N67)8)))))9)))) |
+ | * molecular weight: | ||
+ | ** 554.93 | ||
* common name: | * common name: | ||
− | ** | + | ** 8-ethyl-12-methyl-3-vinyl-bacteriochlorophyllide d |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 3V[E,M]-bacteriochlorophyllide d | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-17429]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | {{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-]C5=C(N67)8)))))9))))}} |
− | + | {{#set: molecular weight=554.93 }} | |
− | + | {{#set: common name=8-ethyl-12-methyl-3-vinyl-bacteriochlorophyllide d}} | |
− | {{#set: | + | {{#set: common name=3V[E,M]-bacteriochlorophyllide d}} |
− | {{#set: | + | {{#set: produced by=RXN-17429}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 18:33, 9 January 2019
Contents
Metabolite CPD-18841
- smiles:
- C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-]C5=C(N67)8)))))9))))
- molecular weight:
- 554.93
- common name:
- 8-ethyl-12-methyl-3-vinyl-bacteriochlorophyllide d
- Synonym(s):
- 3V[E,M]-bacteriochlorophyllide d
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-]C5=C(N67)8)))))9))))" cannot be used as a page name in this wiki.
"3V[E,M]-bacteriochlorophyllide d" cannot be used as a page name in this wiki.