Difference between revisions of "4-PRENYLPHLORISOBUTYROPHENONE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13444 RXN-13444] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13444 RXN-13444] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-PRENYLPHLORISOBUTYROPHENONE 4-PRENYLPHLORISOBUTYROPHENONE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(=CCC1(=C(C=C(C(=C1O)C(C(C)C)=O)O)[O-]))C
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/4.2.1.134 EC-4.2.1.134]
+
** 263.313   
 +
* inchi key:
 +
** InChIKey=IOBXAMCSYCVNET-UHFFFAOYSA-M
 +
* common name:
 +
** 4-prenylphlorisobutyrophenone
 
* Synonym(s):
 
* Synonym(s):
 +
** compound co-X
 +
** PPIBP
 +
** dimethylallyl-phlorisobutyrophenone
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-7813]]
−
** 1 [[CPD-14424]][c] '''=>''' 1 [[CPD-14425]][c] '''+''' 1 [[WATER]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 (5Z,8Z,11Z,14Z,17Z)-3R-hydroxy-docosapentaenoyl-CoA[c] '''=>''' 1 (2E,7Z,10Z,13Z,16Z,19Z)-docosahexaenoyl-CoA[c] '''+''' 1 H2O[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00008580001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
== Pathways  ==
+
−
* [[PWY-7053]], docosahexaenoate biosynthesis I (lower eukaryotes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7053 PWY-7053]
+
−
** '''3''' reactions found over '''7''' reactions in the full pathway
+
−
* [[PWY-7606]], docosahexaenoate biosynthesis III (6-desaturase, mammals): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7606 PWY-7606]
+
−
** '''6''' reactions found over '''14''' reactions in the full pathway
+
−
* [[PWY-7727]], docosahexaenoate biosynthesis IV (4-desaturase, mammals): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7727 PWY-7727]
+
−
** '''3''' reactions found over '''6''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[galdieria.sulphuraria]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: ec number=EC-4.2.1.134}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203134 25203134]
−
{{#set: gene associated=CHC_T00008580001_1}}
+
{{#set: smiles=CC(=CCC1(=C(C=C(C(=C1O)C(C(C)C)=O)O)[O-]))C}}
−
{{#set: in pathway=PWY-7053|PWY-7606|PWY-7727}}
+
{{#set: molecular weight=263.313    }}
−
{{#set: reconstruction category=orthology}}
+
{{#set: inchi key=InChIKey=IOBXAMCSYCVNET-UHFFFAOYSA-M}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: common name=4-prenylphlorisobutyrophenone}}
−
{{#set: reconstruction source=galdieria.sulphuraria}}
+
{{#set: common name=compound co-X|PPIBP|dimethylallyl-phlorisobutyrophenone}}
 +
{{#set: consumed by=RXN-7813}}

Latest revision as of 18:33, 9 January 2019

Metabolite 4-PRENYLPHLORISOBUTYROPHENONE

  • smiles:
    • CC(=CCC1(=C(C=C(C(=C1O)C(C(C)C)=O)O)[O-]))C
  • molecular weight:
    • 263.313
  • inchi key:
    • InChIKey=IOBXAMCSYCVNET-UHFFFAOYSA-M
  • common name:
    • 4-prenylphlorisobutyrophenone
  • Synonym(s):
    • compound co-X
    • PPIBP
    • dimethylallyl-phlorisobutyrophenone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=CCC1(=C(C=C(C(=C1O)C(C(C)C)=O)O)[O-]))C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=4-PRENYLPHLORISOBUTYROPHENONE&oldid=23233"