Difference between revisions of "CPD-15839"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15839 CPD-15839] == * smiles: ** CC(=CCCC(=CCCC(=CCCC1(C)(OC2(C(CC1)=CC(=CC=2C)O)))C)C)C *...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(=CCCC(=CCCC(=CCCC1(C)(OC2(C(CC1)=CC(=CC=2C)O)))C)C)C | ** CC(=CCCC(=CCCC(=CCCC1(C)(OC2(C(CC1)=CC(=CC=2C)O)))C)C)C | ||
| + | * molecular weight: | ||
| + | ** 396.612 | ||
* inchi key: | * inchi key: | ||
** InChIKey=ODADKLYLWWCHNB-LDYBVBFYSA-N | ** InChIKey=ODADKLYLWWCHNB-LDYBVBFYSA-N | ||
* common name: | * common name: | ||
** δ-tocotrienol | ** δ-tocotrienol | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
| Line 16: | Line 16: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=33276 33276] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=33276 33276] | ||
| Line 24: | Line 21: | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5282350 5282350] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5282350 5282350] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C14156 C14156] | ||
| + | * HMDB : HMDB30008 | ||
{{#set: smiles=CC(=CCCC(=CCCC(=CCCC1(C)(OC2(C(CC1)=CC(=CC=2C)O)))C)C)C}} | {{#set: smiles=CC(=CCCC(=CCCC(=CCCC1(C)(OC2(C(CC1)=CC(=CC=2C)O)))C)C)C}} | ||
| + | {{#set: molecular weight=396.612 }} | ||
{{#set: inchi key=InChIKey=ODADKLYLWWCHNB-LDYBVBFYSA-N}} | {{#set: inchi key=InChIKey=ODADKLYLWWCHNB-LDYBVBFYSA-N}} | ||
{{#set: common name=δ-tocotrienol}} | {{#set: common name=δ-tocotrienol}} | ||
| − | |||
{{#set: consumed by=RXN-14919}} | {{#set: consumed by=RXN-14919}} | ||
Latest revision as of 17:33, 9 January 2019
Contents
Metabolite CPD-15839
- smiles:
- CC(=CCCC(=CCCC(=CCCC1(C)(OC2(C(CC1)=CC(=CC=2C)O)))C)C)C
- molecular weight:
- 396.612
- inchi key:
- InChIKey=ODADKLYLWWCHNB-LDYBVBFYSA-N
- common name:
- δ-tocotrienol
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
