Difference between revisions of "CPD-18778"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00009394001 == * left end position: ** 69544 * transcription direction: ** POSITIVE * right end position: ** 70371 * centisome position: ** 85.6...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18778 CPD-18778] == |
− | * | + | * smiles: |
− | ** | + | ** COC1(=C(NCC([O-])=O)CC(CO)(O)CC(=NC(C([O-])=O)CO)1) |
− | * | + | * molecular weight: |
− | ** | + | ** 330.294 |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=WXEQFJUHQIGKNG-MZNRBSSJSA-L |
− | * | + | * common name: |
− | ** | + | ** shinorine |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[extended_PHOSPHASERDECARB-RXN_CPD-18778]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | * [[RXN-17371]] |
== External links == | == External links == | ||
− | {{#set: | + | {{#set: smiles=COC1(=C(NCC([O-])=O)CC(CO)(O)CC(=NC(C([O-])=O)CO)1)}} |
− | {{#set: | + | {{#set: molecular weight=330.294 }} |
− | {{#set: | + | {{#set: inchi key=InChIKey=WXEQFJUHQIGKNG-MZNRBSSJSA-L}} |
− | {{#set: | + | {{#set: common name=shinorine}} |
− | {{#set: | + | {{#set: consumed by=extended_PHOSPHASERDECARB-RXN_CPD-18778}} |
+ | {{#set: reversible reaction associated=RXN-17371}} |
Latest revision as of 17:35, 9 January 2019
Contents
Metabolite CPD-18778
- smiles:
- COC1(=C(NCC([O-])=O)CC(CO)(O)CC(=NC(C([O-])=O)CO)1)
- molecular weight:
- 330.294
- inchi key:
- InChIKey=WXEQFJUHQIGKNG-MZNRBSSJSA-L
- common name:
- shinorine
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"COC1(=C(NCC([O-])=O)CC(CO)(O)CC(=NC(C([O-])=O)CO)1)" cannot be used as a page name in this wiki.