Difference between revisions of "CPD-18778"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00009394001 == * left end position: ** 69544 * transcription direction: ** POSITIVE * right end position: ** 70371 * centisome position: ** 85.6...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene CHC_T00009394001 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18778 CPD-18778] ==
* left end position:
+
* smiles:
** 69544
+
** COC1(=C(NCC([O-])=O)CC(CO)(O)CC(=NC(C([O-])=O)CO)1)
* transcription direction:
+
* molecular weight:
** POSITIVE
+
** 330.294   
* right end position:
+
* inchi key:
** 70371
+
** InChIKey=WXEQFJUHQIGKNG-MZNRBSSJSA-L
* centisome position:
+
* common name:
** 85.64637   
+
** shinorine
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[PROTEIN-KINASE-RXN]]
+
* [[extended_PHOSPHASERDECARB-RXN_CPD-18778]]
** original_genome
+
== Reaction(s) known to produce the compound ==
***automated-name-match
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
* [[RXN-17371]]
 
== External links  ==
 
== External links  ==
{{#set: left end position=69544}}
+
{{#set: smiles=COC1(=C(NCC([O-])=O)CC(CO)(O)CC(=NC(C([O-])=O)CO)1)}}
{{#set: transcription direction=POSITIVE}}
+
{{#set: molecular weight=330.294    }}
{{#set: right end position=70371}}
+
{{#set: inchi key=InChIKey=WXEQFJUHQIGKNG-MZNRBSSJSA-L}}
{{#set: centisome position=85.64637    }}
+
{{#set: common name=shinorine}}
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
+
{{#set: consumed by=extended_PHOSPHASERDECARB-RXN_CPD-18778}}
 +
{{#set: reversible reaction associated=RXN-17371}}

Latest revision as of 18:35, 9 January 2019

Metabolite CPD-18778

  • smiles:
    • COC1(=C(NCC([O-])=O)CC(CO)(O)CC(=NC(C([O-])=O)CO)1)
  • molecular weight:
    • 330.294
  • inchi key:
    • InChIKey=WXEQFJUHQIGKNG-MZNRBSSJSA-L
  • common name:
    • shinorine
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"COC1(=C(NCC([O-])=O)CC(CO)(O)CC(=NC(C([O-])=O)CO)1)" cannot be used as a page name in this wiki.